Molecular weights calculated on 04/28/21 | Molecular weights calculated on 04/30/21 |
Molar mass of Ba(OH)2 is 171.34168 g/mol
Molar mass of Na2O is 61.97893856 g/mol
Molar mass of [Na][C3H5O3][C15H33CO][C17H35CO][C17H35CO] is 888.43218928 g/mol
Molar mass of C6H12O6 is 180.15588 g/mol
Molar mass of Ca(HSO3)2 is 202.22028 g/mol
Molar mass of [Na][C3H5O3][C15H31CO][C17H35CO][C17H35CO] is 886.41630928 g/mol
Molar mass of methane is 16.04246 g/mol
Molar mass of Cl2 is 70.906 g/mol
Molar mass of Hydrogen is 2.01588 g/mol
Molar mass of V2(TeO3)3 is 628.6776 g/mol
Molar mass of Al2(SO4)3 is 342.1508772 g/mol
Molar mass of CH3NH2 is 31.0571 g/mol
Molar mass of CH3NH3Cl is 67.51804 g/mol
Molar mass of O2 is 31.9988 g/mol
Molar mass of H3PO4 is 97.995182 g/mol
Molar mass of MgS is 56.37 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of C2H5CH is 42.07974 g/mol
Molar mass of C2H3Cl is 62.49822 g/mol
Molar mass of [K][C3H5O3][C15H31CO][C17H35CO][C17H35CO] is 902.52484 g/mol
Molar mass of Ca(OH)2 is 74.09268 g/mol
Molar mass of [K][C3H5O3][C15H33CO][C17H35CO][C17H35CO] is 904.54072 g/mol
Molar mass of H3P04 is 126.918868 g/mol
Molar mass of S is 32.065 g/mol
Molar mass of [K][C3H5O3][C15H35CO][C17H35CO][C17H35CO] is 906.5566 g/mol
Molar mass of Na2S2O3*5H2O is 248.18413856 g/mol
Molar mass of BaCl2 is 208.233 g/mol
Molar mass of H3PO4 is 97.995182 g/mol
Molar mass of [K][C3H5O3][C17H35CO][C17H35CO][C17H35CO] is 930.578 g/mol
Molar mass of BaCl2 is 208.233 g/mol
Molar mass of [K][C3H5O3][C17H35CO][C17H33CO][C17H35CO] is 928.56212 g/mol
Molar mass of N2 is 28.0134 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of CuBr is 143.45 g/mol
Molar mass of Al is 26.9815386 g/mol
Molar mass of Pb(NO3)2 is 331.2098 g/mol
Molar mass of Cu2SO42 is 831.1318 g/mol
Molar mass of C6H12O6 is 180.15588 g/mol
Molar mass of HC7H5O2 is 122.12134 g/mol
Molar mass of FeS is 87.91 g/mol
Molar mass of Ba(HSO4)2 is 331.46808 g/mol
Molar mass of FeSO4 is 151.9076 g/mol
Molar mass of Fe2O3 is 159.6882 g/mol
Molar mass of C6H11O2 is 115.15034 g/mol
Molar mass of NaHCO3 is 84.00660928 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of FeCl2*6H2O is 234.84268 g/mol
Molar mass of C6H12O2 is (acido g/mol
Calculate molecular weight
Molecular weights calculated on 04/28/21 | Molecular weights calculated on 04/30/21 |
Molecular masses on 03/30/21
Molecular masses on 04/29/20
Please let us know how we can improve this web app.