Molecular weights calculated on 04/28/21 | Molecular weights calculated on 04/30/21 |
Molar mass of Ca3cl7 is 368.405 g/mol
Molar mass of FeCl3 is 162.204 g/mol
Molar mass of CH2F2 is 52.0233864 g/mol
Molar mass of [FeSO4(NH4)2SO4] is 284.04712 g/mol
Molar mass of AlCl2 is 97.8875386 g/mol
Molar mass of H2CH3COOH is 62.06784 g/mol
Molar mass of *5MgSO4 is 601.838 g/mol
Molar mass of C is 12.0107 g/mol
Molar mass of [K][C3H5O3][C15H31CO][C15H31CO][C17H33CO] is 872.4558 g/mol
Molar mass of SiC is 40.0962 g/mol
Molar mass of C6H10O5 is 162.1406 g/mol
Molar mass of CH3COOH is 60.05196 g/mol
Molar mass of Cu2O is 143.0914 g/mol
Molar mass of (NH is 3 g/mol
Molar mass of AlCl3 is 133.3405386 g/mol
Molar mass of Au is 196.966569 g/mol
Molar mass of c2h4o2Na is 83.04172928 g/mol
Molar mass of iron is 55.845 g/mol
Molar mass of [K][C3H5O3][C15H31CO][C15H33CO][C17H33CO] is 874.47168 g/mol
Molar mass of SiC is 40.0962 g/mol
Molar mass of Ba2 is 274.654 g/mol
Molar mass of [K][C3H5O3][C15H31CO][C15H33CO][C17H31CO] is 872.4558 g/mol
Molar mass of O2 is 31.9988 g/mol
Molar mass of O2 is 31.9988 g/mol
Molar mass of C5H7N is 81.11578 g/mol
Molar mass of NaClO3 is 106.44096928 g/mol
Molar mass of CaCO3 is 100.0869 g/mol
Molar mass of [K][C3H5O3][C15H31CO][C15H33CO][C17H35CO] is 876.48756 g/mol
Molar mass of CO is 28.0101 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of NaHCO is 3 g/mol
Molar mass of SO2 is 64.0638 g/mol
Molar mass of [K][C3H5O3][C15H31CO][C15H35CO][C17H35CO] is 878.50344 g/mol
Molar mass of (SO is 2 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of KMnO4 is 158.033945 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of PCl5 is 208.238762 g/mol
Molar mass of [Na][C3H5O3][C15H31CO][C15H35CO][C17H35CO] is 862.39490928 g/mol
Molar mass of NaBr is 102.89376928 g/mol
Molar mass of N2 is 28.0134 g/mol
Molar mass of C12H22O11 is 342.29648 g/mol
Molar mass of NaOH*H2O is 58.01238928 g/mol
Molar mass of SiO2 is 60.0843 g/mol
Molar mass of [Na][C3H5O3][C15H33CO][C15H35CO][C17H35CO] is 864.41078928 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of H2SO4 is 98.07848 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of H2CO2 is 46.02538 g/mol
Calculate molecular weight
Molecular weights calculated on 04/28/21 | Molecular weights calculated on 04/30/21 |
Molecular masses on 03/30/21
Molecular masses on 04/29/20
Please let us know how we can improve this web app.