Molecular weights calculated on 04/28/21 | Molecular weights calculated on 04/30/21 |
Molar mass of CaO2 is 72.0768 g/mol
Molar mass of KNO3 is 101.1032 g/mol
Molar mass of (CH3)2O is 46.06844 g/mol
Molar mass of Co(OH)2 is 92.947875 g/mol
Molar mass of MnBr2 is 214.746045 g/mol
Molar mass of Ag is 107.8682 g/mol
Molar mass of [K][C3H5O3][C15H31CO][C15H31CO][C17H33CO] is 872.4558 g/mol
Molar mass of Ag is 107.8682 g/mol
Molar mass of Cr(NO3)3 is 238.0108 g/mol
Molar mass of MnBr7 is 614.266045 g/mol
Molar mass of GE is 72.64 g/mol
Molar mass of Zn(OH)2 is 99.39468 g/mol
Molar mass of SI is 28.0855 g/mol
Molar mass of KClO3 is 122.5495 g/mol
Molar mass of GE is 72.64 g/mol
Molar mass of COOH is 45.01744 g/mol
Molar mass of Cl2 is 70.906 g/mol
Molar mass of H4C is 16.04246 g/mol
Molar mass of Pt(BrO3)4 is 706.6928 g/mol
Molar mass of C9H18 is 126.23922 g/mol
Molar mass of I2O7 is 365.80474 g/mol
Molar mass of Cl is 35.453 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of CH4N2O is 60.05526 g/mol
Molar mass of Al is 26.9815386 g/mol
Molar mass of K0H is 40.10624 g/mol
Molar mass of Al(OH)3 is 78.0035586 g/mol
Molar mass of Fe3O4 is 231.5326 g/mol
Molar mass of CrCl3 is 158.3551 g/mol
Molar mass of CH2(OH)CH2(OH)CH2(OH) is 93.10176 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of C8H16 is 112.21264 g/mol
Molar mass of CaO is 56.0774 g/mol
Molar mass of LaCa2Zr2Fe3O12 is 761.03727 g/mol
Molar mass of Barium is peroxide g/mol
Molar mass of benzene is 78.11184 g/mol
Molar mass of H2SO3 is 82.07908 g/mol
Molar mass of No2 is 46.0055 g/mol
Molar mass of [][C3H5O3][C15H31CO][C15H31CO][C17H33CO] is 833.3575 g/mol
Molar mass of HNO3 is 63.01284 g/mol
Molar mass of HgS is 232.655 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of neon is 20.1797 g/mol
Molar mass of [Na][C3H5O3][C15H31CO][C15H31CO][C17H33CO] is 856.34726928 g/mol
Molar mass of Na2S is 78.04453856 g/mol
Molar mass of (Cl2C6H4) is C2HCl g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of Cu is 63.546 g/mol
Molar mass of Ca3(PO4)2 is 310.176724 g/mol
Calculate molecular weight
Molecular weights calculated on 04/28/21 | Molecular weights calculated on 04/30/21 |
Molecular masses on 03/30/21
Molecular masses on 04/29/20
Please let us know how we can improve this web app.