Molecular weights calculated on 02/09/15 | Molecular weights calculated on 02/11/15 |
Molar mass of H2O is 18.01528 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of Cd(NO3)2 is 236.4208 g/mol
Molar mass of Ca3(PO4)3 is 405.148086 g/mol
Molar mass of C6H5CH3 is 92.13842 g/mol
Molar mass of CoCl26H2O is 998.726475 g/mol
Molar mass of NH4OH is 35.0458 g/mol
Molar mass of [Ni(H2NCH2CH2NH2)3]Cl2 is 309.89436 g/mol
Molar mass of na2co3 is 222.77912356 g/mol
Molar mass of SiO2 is 60.0843 g/mol
Molar mass of k2s is 110.2616 g/mol
Molar mass of (KH2PO4) is 136.085542 g/mol
Molar mass of C12H8Cl2N2Pd is 357.53132 g/mol
Molar mass of (NH4)2SO4 is 132.13952 g/mol
Molar mass of na2CO3 is 105.98843856 g/mol
Molar mass of KCN is 65.1157 g/mol
Molar mass of (NH4)10W12O41 is 3042.44 g/mol
Molar mass of AgCN is 133.8856 g/mol
Molar mass of Mg(NO3)2 is 148.3148 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of CH3(CH2)16CO(OCH2CH2)100OH is 4689.73324 g/mol
Molar mass of SiO2 is 60.0843 g/mol
Molar mass of SiO2 is 60.0843 g/mol
Molar mass of Al2(SO4)3 is 342.1508772 g/mol
Molar mass of Al2S3 is 150.1580772 g/mol
Molar mass of [Al(H2O)6](NO3)3 is 321.0879186 g/mol
Molar mass of K3PO4 is 212.266262 g/mol
Molar mass of CF4 is 88.0043128 g/mol
Molar mass of MgCO3 is 84.3139 g/mol
Molar mass of CH4 is 16.04246 g/mol
Molar mass of KCl is 74.5513 g/mol
Molar mass of (NH4)2SO4 is 132.13952 g/mol
Molar mass of BaI2 is 391.13594 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of Cr(oh)3 is 155.9883 g/mol
Molar mass of Fe(NO2)3 is 193.8615 g/mol
Molar mass of NH4Cl is 53.49146 g/mol
Molar mass of NH4Cl is 53.49146 g/mol
Molar mass of C5H10(OH)2 is 104.14758 g/mol
Molar mass of KCl is 74.5513 g/mol
Molar mass of HBr is 80.91194 g/mol
Molar mass of C12H22O11 is 342.29648 g/mol
Molar mass of C6H5OHNa is 117.10100928 g/mol
Molar mass of C12H22O11 is 342.29648 g/mol
Molar mass of C6H12O6 is 180.15588 g/mol
Molar mass of k3FeC6O12 is 437.1969 g/mol
Molar mass of BeCl2 is 79.918182 g/mol
Molar mass of P4S3 is 220.090048 g/mol
Molar mass of Cu3As is 265.5596 g/mol
Calculate molecular weight
Molecular weights calculated on 02/09/15 | Molecular weights calculated on 02/11/15 |
Molecular masses on 01/11/15
Molecular masses on 02/10/14
Please let us know how we can improve this web app.