Molecular weights calculated on 02/09/15 | Molecular weights calculated on 02/11/15 |
Molar mass of Cu is 63.546 g/mol
Molar mass of potassium is sulfate g/mol
Molar mass of CaCl2 is 110.984 g/mol
Molar mass of C3H8 is 44.09562 g/mol
Molar mass of CH3C(CH3)2CH3 is 72.14878 g/mol
Molar mass of Fe3(PO4)2 is 357.477724 g/mol
Molar mass of (NH4)2CO3 is 96.08582 g/mol
Molar mass of Na2AlF6 is 186.95149636 g/mol
Molar mass of K2C2O4 is 166.2156 g/mol
Molar mass of BF3 is 67.8062096 g/mol
Molar mass of CH3CH2CH2CH2CH3 is 72.14878 g/mol
Molar mass of (NH4)3PO4 is 149.086742 g/mol
Molar mass of CCl2F2 is 120.9135064 g/mol
Molar mass of SiO2 is 60.0843 g/mol
Molar mass of Br is 79.904 g/mol
Molar mass of HF is 20.0063432 g/mol
Molar mass of Cu2(C28H20N4O)(PF6)(CH3COO)CH20 is 791.7543012 g/mol
Molar mass of TiAl is 74.8485386 g/mol
Molar mass of Na3AlF6 is 209.94126564 g/mol
Molar mass of Mg(OH)2 is 58.31968 g/mol
Molar mass of MgCl2 is * g/mol
Molar mass of ClCH2CH3 is 64.5141 g/mol
Molar mass of (H2O)6 is 108.09168 g/mol
Molar mass of FeCl2 is 126.751 g/mol
Molar mass of C2H4 is 28.05316 g/mol
Molar mass of UF6 is 352.0193292 g/mol
Molar mass of Pb(NO3)2 is 331.2098 g/mol
Molar mass of Cu2(C28H23N4O)(PF6)(CH3COO)CH20 is 794.7781212 g/mol
Molar mass of Li2SO4 is 109.9446 g/mol
Molar mass of Al2(SO4)3 is 342.1508772 g/mol
Molar mass of Li2SO4 is 109.9446 g/mol
Molar mass of K2Cu(C2O4)2 is 317.7806 g/mol
Molar mass of C2H3O is 43.04462 g/mol
Molar mass of ICl is 162.35747 g/mol
Molar mass of (NH4) is 18.03846 g/mol
Molar mass of Ba(OH)2 is 171.34168 g/mol
Molar mass of NaI is 149.89423928 g/mol
Molar mass of (CH4)8 is 128.33968 g/mol
Molar mass of MgCl2(H2O)6 is 203.30268 g/mol
Molar mass of CaCl2 is 110.984 g/mol
Molar mass of SO2 is 64.0638 g/mol
Molar mass of C9H11NO2 is 165.18914 g/mol
Molar mass of Ni is 58.6934 g/mol
Molar mass of Cu2(C28H23N4O)(PF6)(CH3COO) is 762.6086212 g/mol
Molar mass of Cu(so)4 is 254.184 g/mol
Molar mass of C12H22O11 is 342.29648 g/mol
Molar mass of KBr is 119.0023 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of Acetic is acid g/mol
Calculate molecular weight
Molecular weights calculated on 02/09/15 | Molecular weights calculated on 02/11/15 |
Molecular masses on 01/11/15
Molecular masses on 02/10/14
Please let us know how we can improve this web app.