Molecular weights calculated on 02/09/15 | Molecular weights calculated on 02/11/15 |
Molar mass of CH3CH2CH2CH2CH20H is 90.2917 g/mol
Molar mass of NO3 is 62.0049 g/mol
Molar mass of Pb is 207.2 g/mol
Molar mass of Ca(OCl)2 is 142.9828 g/mol
Molar mass of Fe is 55.845 g/mol
Molar mass of Mg(NO3)2*6H2O is 256.40648 g/mol
Molar mass of AgNO3 is 169.8731 g/mol
Molar mass of CH4N2O is 60.05526 g/mol
Molar mass of NO3 is 62.0049 g/mol
Molar mass of CuSO4 is 159.6086 g/mol
Molar mass of Na2(edta) is 45.97953856 g/mol
Molar mass of C35H22N6Na4S3O14 is 938.73505712 g/mol
Molar mass of C14H7Cl7 is 423.37638 g/mol
Molar mass of K2SO4*MgSO4*7H2O is 420.73376 g/mol
Molar mass of KHC8H4O4 is 204.2212 g/mol
Molar mass of Al2(SO4)3 is 342.1508772 g/mol
Molar mass of PO2 is 62.972562 g/mol
Molar mass of MnSO4 is 151.000645 g/mol
Molar mass of Ca(OH)2 is 74.09268 g/mol
Molar mass of (CH3CO2)2Pd is 224.50804 g/mol
Molar mass of H3CO4 is 79.03212 g/mol
Molar mass of [Co(NH3)4CO3]NO3 is 249.069075 g/mol
Molar mass of Cl3CCH(OH)NHCONHCH(OH)CCl3 is 354.83074 g/mol
Molar mass of glucose is 180.15588 g/mol
Molar mass of CCHCCOOHCHCOOH is 140.09356 g/mol
Molar mass of Na2S2O3 is 158.10773856 g/mol
Molar mass of MgSO4 is 120.3676 g/mol
Molar mass of CCHCHCOOHCHCOOH is 141.1015 g/mol
Molar mass of C5As4 is 359.7399 g/mol
Molar mass of (NH3)2CO2 is 78.07054 g/mol
Molar mass of AsNa3 is 143.89090784 g/mol
Molar mass of NaH2PO4 is 119.97701128 g/mol
Molar mass of H4CO is 32.04186 g/mol
Molar mass of COH4 is 32.04186 g/mol
Molar mass of (Na2HPO4) is 141.95884056 g/mol
Molar mass of NaH2PO4*12h2o is 336.16037128 g/mol
Molar mass of Al(OH)3 is 78.0035586 g/mol
Molar mass of B is 10.811 g/mol
Molar mass of C2H5Br is 108.9651 g/mol
Molar mass of C19H38 is 266.50502 g/mol
Molar mass of AlCl3 is 133.3405386 g/mol
Molar mass of P2O5 is 141.944524 g/mol
Molar mass of NiCl2 is 129.5994 g/mol
Molar mass of SrO is 103.6194 g/mol
Molar mass of (NH4)2SO4 is 132.13952 g/mol
Molar mass of SrO is 103.6194 g/mol
Molar mass of C7H5N3O6 is 227.1311 g/mol
Molar mass of Al2O3 is 101.9612772 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Calculate molecular weight
Molecular weights calculated on 02/09/15 | Molecular weights calculated on 02/11/15 |
Molecular masses on 01/11/15
Molecular masses on 02/10/14
Please let us know how we can improve this web app.