Molecular weights calculated on 01/10/21 | Molecular weights calculated on 01/12/21 |
Molar mass of HCO3 is 61.01684 g/mol
Molar mass of Ba(C2H3O2)2 is 255.41504 g/mol
Molar mass of h20 is 20.1588 g/mol
Molar mass of Na2CO3 is 105.98843856 g/mol
Molar mass of CHCl3 is 119.37764 g/mol
Molar mass of CH3(OCH2CH2)9OCOC(CH2)CH3 is 496.58886 g/mol
Molar mass of N2 is 28.0134 g/mol
Molar mass of Co is 28.0101 g/mol
Molar mass of IrCN2C11H11N2C11H11N2C11OH8 is 730.8586 g/mol
Molar mass of koh is 56.10564 g/mol
Molar mass of IrN2C11H11N2C11H11N2C11OH8 is 718.8479 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of K[Cr(C2O4)2(H2O)2] is 303.16296 g/mol
Molar mass of IrN2C11H11N2C11H11N2C11OH8CH2Cl2 is 803.78048 g/mol
Molar mass of H2 is 2.01588 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of MgCl2 is 95.211 g/mol
Molar mass of F2 is 37.9968064 g/mol
Molar mass of Fe is 55.845 g/mol
Molar mass of C is 12.0107 g/mol
Molar mass of C9H8O4 is 180.15742 g/mol
Molar mass of C9 is 108.0963 g/mol
Molar mass of Fe is 55.845 g/mol
Molar mass of CuO is 79.5454 g/mol
Molar mass of CuO is 79.5454 g/mol
Molar mass of PH3 is 33.997582 g/mol
Molar mass of AgNO3 is 169.8731 g/mol
Molar mass of AgNO3 is 169.8731 g/mol
Molar mass of nh3 is 17.03052 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of HNO3 is 63.01284 g/mol
Molar mass of CaCl2 is 110.984 g/mol
Molar mass of CaCl2 is 110.984 g/mol
Molar mass of Mo(CO)6 is 264.0206 g/mol
Molar mass of (NiC4H7O2N2)2 is 347.60796 g/mol
Molar mass of CuSO4*5H2O is 249.685 g/mol
Molar mass of C2H6O is 46.06844 g/mol
Molar mass of C17H35COO is 283.4693 g/mol
Molar mass of H2HCO3 is 63.03272 g/mol
Molar mass of NaC6H5O7 is 212.08946928 g/mol
Molar mass of H2SO4 is 98.07848 g/mol
Molar mass of Ca(OH)2 is 74.09268 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of Cu is 63.546 g/mol
Molar mass of Ca(OH)2 is 74.09268 g/mol
Molar mass of C4H10 is 58.1222 g/mol
Molar mass of helium is 4.002602 g/mol
Molar mass of CuO is 79.5454 g/mol
Molar mass of K20 is 781.966 g/mol
Calculate molecular weight
Molecular weights calculated on 01/10/21 | Molecular weights calculated on 01/12/21 |
Molecular masses on 12/12/20
Molecular masses on 01/11/20
Please let us know how we can improve this web app.