Molecular weights calculated on 01/10/21 | Molecular weights calculated on 01/12/21 |
Molar mass of Ca(OH)2 is 74.09268 g/mol
Molar mass of H2SO4 is 98.07848 g/mol
Molar mass of CH4 is 16.04246 g/mol
Molar mass of CH4 is 16.04246 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of Cu(C2H3O2)2 is 181.63404 g/mol
Molar mass of NH4F is 37.0368632 g/mol
Molar mass of MnCl2 is 125.844045 g/mol
Molar mass of NI3 is 394.72011 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of ZnS is 97.445 g/mol
Molar mass of H2SO4 is 98.07848 g/mol
Molar mass of C8H9F2 is 143.1538664 g/mol
Molar mass of H2SO4 is 98.07848 g/mol
Molar mass of KMnO4 is 158.033945 g/mol
Molar mass of Na2SO4 is 142.04213856 g/mol
Molar mass of C4H9OH is 74.1216 g/mol
Molar mass of NH4NO2 is 64.04396 g/mol
Molar mass of magnesium is 24.305 g/mol
Molar mass of Na2SO4 is 142.04213856 g/mol
Molar mass of C12H22O11 is 342.29648 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of Cr2(SO4)3 is 392.18 g/mol
Molar mass of CH3COOH is 60.05196 g/mol
Molar mass of C8H18F2 is 152.2253264 g/mol
Molar mass of magnesium is 24.305 g/mol
Molar mass of SO2 is 64.0638 g/mol
Molar mass of H3PO is 49.996982 g/mol
Molar mass of sulfur is 32.065 g/mol
Molar mass of LiCl is 42.394 g/mol
Molar mass of C8H17OH is 130.22792 g/mol
Molar mass of *3fe2o3 is 479.0646 g/mol
Molar mass of Fe(OH)3 is 106.86702 g/mol
Molar mass of CaCl2 is 110.984 g/mol
Molar mass of aluminium is 26.9815386 g/mol
Molar mass of Sb4(H2Si2O5)5 is 1177.9594 g/mol
Molar mass of N2H8SO4 is 132.13952 g/mol
Molar mass of CH3(CH2)10CH2(OCH2CH2)2OSO3Na is 376.48438928 g/mol
Molar mass of KMno4 is 158.033945 g/mol
Molar mass of Ca3(Fe(CN)6)2 is 544.1328 g/mol
Molar mass of NHC2H6 is 45.08368 g/mol
Molar mass of Na2SO4 is 142.04213856 g/mol
Molar mass of NH2 is 16.02258 g/mol
Molar mass of NH2 is 16.02258 g/mol
Molar mass of NH2 is 16.02258 g/mol
Molar mass of NH2 is 16.02258 g/mol
Molar mass of NH2 is 16.02258 g/mol
Molar mass of KMNO4 is 158.033945 g/mol
Molar mass of NH2 is 16.02258 g/mol
Calculate molecular weight
Molecular weights calculated on 01/10/21 | Molecular weights calculated on 01/12/21 |
Molecular masses on 12/12/20
Molecular masses on 01/11/20
Please let us know how we can improve this web app.