Molecular weights calculated on 02/09/16 | Molecular weights calculated on 02/11/16 |
Molar mass of (Na2HPO4)2H2O is 301,93296112 g/mol
Molar mass of SO2Cl2 is 134.9698 g/mol
Molar mass of C18H24O2 is 272,38196 g/mol
Molar mass of C6H4Cl2 is 147.00196 g/mol
Molar mass of cu is 63.546 g/mol
Molar mass of NH4Cl is 53,49146 g/mol
Molar mass of NH4Br is 97,94246 g/mol
Molar mass of Cu2(CH3COOH)4(CH3OH)2(C6H12N3PO)2 is 777.689044 g/mol
Molar mass of Zn(CH3COO)2*2H2O is 219.4986 g/mol
Molar mass of Cu2(CH3COO)4(CH3OH)2(C6H12N3PO)2 is 773.657284 g/mol
Molar mass of C2H5OH is 46.06844 g/mol
Molar mass of CH3COOH is 60,05196 g/mol
Molar mass of C4H6O6 is 150.08684 g/mol
Molar mass of KCl is 74.5513 g/mol
Molar mass of (NH4)2PO4 is 131.048282 g/mol
Molar mass of CaCl2 is 110.984 g/mol
Molar mass of Na2S2H2 is 112.12541856 g/mol
Molar mass of f is 18.9984032 g/mol
Molar mass of CH3CH2OH is 46,06844 g/mol
Molar mass of Al is 26.9815386 g/mol
Molar mass of C2H5COOH is 74.07854 g/mol
Molar mass of NaHCO3 is 84.00660928 g/mol
Molar mass of zn is 65.38 g/mol
Molar mass of (B(PO4)) is 105.782362 g/mol
Molar mass of H2CO2 is 46,02538 g/mol
Molar mass of S is 32.065 g/mol
Molar mass of c2h4 is 28.05316 g/mol
Molar mass of Na2CO3 is 105.98843856 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of Mg(NO3)2 is 148.3148 g/mol
Molar mass of Na2S is 78.04453856 g/mol
Molar mass of TiSe is 126.827 g/mol
Molar mass of Na2SO3 is 126,04273856 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of h3po4 is formula g/mol
Molar mass of C26H10N18S4Mn(H20)3 is 818,152645 g/mol
Molar mass of C26H10N18S4Mn(H2O)3 is 811,722085 g/mol
Molar mass of C26H10N18S4Mn(H2O)4 is 829,737365 g/mol
Molar mass of C26H10N18S4Mn(H2O) is 775,691525 g/mol
Molar mass of Cu2o is 143.0914 g/mol
Molar mass of Fe2(SO4)3 is 399,8778 g/mol
Molar mass of Ba(NO3)2*H2O is 279.35208 g/mol
Molar mass of V3p5 is 307.69331 g/mol
Molar mass of Ba(NO3)2*6H2O is 369.42848 g/mol
Molar mass of (NH4)3 is PO4 g/mol
Molar mass of Ca3(PO4)2 is 310.176724 g/mol
Molar mass of Na is 22.98976928 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of Na2SH18O9 is 240.18205856 g/mol
Calculate molecular weight
Molecular weights calculated on 02/09/16 | Molecular weights calculated on 02/11/16 |
Molecular masses on 01/11/16
Molecular masses on 02/10/15
Please let us know how we can improve this web app.