Molecular weights calculated on 02/09/16 | Molecular weights calculated on 02/11/16 |
Molar mass of Li3PO4 is 115.794362 g/mol
Molar mass of O is 15.9994 g/mol
Molar mass of N2O5 is 108.0104 g/mol
Molar mass of ethane is 30.06904 g/mol
Molar mass of ZnBr2 is 225,188 g/mol
Molar mass of NH4F is 37.0368632 g/mol
Molar mass of al3o3 is 128,9428158 g/mol
Molar mass of NH4 is 18.03846 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of H2CO3 is 62,02478 g/mol
Molar mass of Cd is 112.411 g/mol
Molar mass of H3PO4 is 97.995182 g/mol
Molar mass of (NH4)2Cr2O7 is 252,06492 g/mol
Molar mass of ClO3 is 83.4512 g/mol
Molar mass of Fe2O3 is 159.6882 g/mol
Molar mass of o2 is 31.9988 g/mol
Molar mass of KBr is 119.0023 g/mol
Molar mass of CH3COOH is 60.05196 g/mol
Molar mass of (NH4)2SO4 is 132,13952 g/mol
Molar mass of C12H24O6 is 264.31536 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of n2o is 44.0128 g/mol
Molar mass of EtBz is 134.1751 g/mol
Molar mass of (NH4)2SO4 is 132.13952 g/mol
Molar mass of N2O is 44.0128 g/mol
Molar mass of Al2(CO3)3 is 233.9897772 g/mol
Molar mass of NaOH is 3M g/mol
Molar mass of CH3OH is 32.04186 g/mol
Molar mass of CH3OH is 32.04186 g/mol
Molar mass of NiBr(C6H13NO4S)(P(C6H5)3)2 is 858.405044 g/mol
Molar mass of [Co(NH3)5ONO]Cl2 is 260.997295 g/mol
Molar mass of CaU2Si2O11*7H2O is 874.40718 g/mol
Molar mass of HC2H3O2 is 60.05196 g/mol
Molar mass of Zn(C2H3O2)2 is 183.46804 g/mol
Molar mass of Cr is 51.9961 g/mol
Molar mass of NaC2H3O2 is 82.03378928 g/mol
Molar mass of CoCl3*5NH3 is 250.444795 g/mol
Molar mass of Y2(CO3)3 is 357.8384 g/mol
Molar mass of MgCO3 is 84.3139 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of Ca10(PO4)6(OH)2 is 1004.622852 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of MgCO3 is 84.3139 g/mol
Molar mass of K2S2O3 is 190,3248 g/mol
Molar mass of Hg2I2 is 654.98894 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of Cu is 63.546 g/mol
Molar mass of C3H6O is 58.07914 g/mol
Molar mass of H2CO3 is 62.02478 g/mol
Calculate molecular weight
Molecular weights calculated on 02/09/16 | Molecular weights calculated on 02/11/16 |
Molecular masses on 01/11/16
Molecular masses on 02/10/15
Please let us know how we can improve this web app.