Molecular weights calculated on 11/17/15 | Molecular weights calculated on 11/19/15 |
Molar mass of Al is 26.9815386 g/mol
Molar mass of ((NH2)2CO) is 60.05526 g/mol
Molar mass of Bu is 57.11426 g/mol
Molar mass of N2 is 28.0134 g/mol
Molar mass of BuCl is 92.56726 g/mol
Molar mass of H2PO4 is nombre g/mol
Molar mass of HNO3 is 63.01284 g/mol
Molar mass of NaHCO3 is 84.00660928 g/mol
Molar mass of (Na4)2SO4 is 279.98075424 g/mol
Molar mass of C12H22O11 is 342.29648 g/mol
Molar mass of C2H6 is 30.06904 g/mol
Molar mass of CH3(CH2)nC(O)N(CH2CH2OH)2 is 175,2056 g/mol
Molar mass of CH3(CH2)nC(O)N(CH2CH2OH)2 is 175,2056 g/mol
Molar mass of Na332 is 7632.60340096 g/mol
Molar mass of (NH4)2SO4 is 132.13952 g/mol
Molar mass of K3PO4 is 212.266262 g/mol
Molar mass of K3PO4 is 212.266262 g/mol
Molar mass of NiCl2 is 129.5994 g/mol
Molar mass of Co2 is 117,86639 g/mol
Molar mass of CO2 is 44,0095 g/mol
Molar mass of CO2 is 44,0095 g/mol
Molar mass of F2 is + g/mol
Molar mass of O is 15,9994 g/mol
Molar mass of S is 32,065 g/mol
Molar mass of C2H2(COOH)2 is 116.07216 g/mol
Molar mass of NaH2PO4 is 119.97701128 g/mol
Molar mass of na is 22.98976928 g/mol
Molar mass of AgNO3 is 169.8731 g/mol
Molar mass of C6H12O6 is 180.15588 g/mol
Molar mass of C6H12O6 is 180.15588 g/mol
Molar mass of K2CrO4 is 194.1903 g/mol
Molar mass of FeCl3H12O6 is 270.29568 g/mol
Molar mass of FeCl3H12O6 is 270.29568 g/mol
Molar mass of C2(COOH)2 is 114.05628 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of C6H5OH is 94.11124 g/mol
Molar mass of CaCO3 is 100,0869 g/mol
Molar mass of C7H16O is 116,20134 g/mol
Molar mass of Al2(SO4)3 is 342.1508772 g/mol
Molar mass of C2H5OH is 46.06844 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of Ba is 137.327 g/mol
Molar mass of Cr is 51.9961 g/mol
Molar mass of MgCO3 is 84,3139 g/mol
Molar mass of MgCO3 is 84,3139 g/mol
Molar mass of co2 is 117.86639 g/mol
Molar mass of NH4NO3 is 80.04336 g/mol
Molar mass of O is 15.9994 g/mol
Molar mass of NH4SCN is 76.12086 g/mol
Calculate molecular weight
Molecular weights calculated on 11/17/15 | Molecular weights calculated on 11/19/15 |
Molecular masses on 10/19/15
Molecular masses on 11/18/14
Please let us know how we can improve this web app.