Molecular weights calculated on 11/17/15 | Molecular weights calculated on 11/19/15 |
Molar mass of C24H26N2O4RuS2(CH3CH2)3NCl is 708,31724 g/mol
Molar mass of C6H5NO2 is 123.1094 g/mol
Molar mass of NH3(ClO4)2 is 215.93172 g/mol
Molar mass of CuO is 79.5454 g/mol
Molar mass of Ni is 58.6934 g/mol
Molar mass of KMnO4 is 158.033945 g/mol
Molar mass of C24H26N2O4RuS2(CH3CH2)3NHCl is 709,32518 g/mol
Molar mass of NiO is 74.6928 g/mol
Molar mass of Ti is 47.867 g/mol
Molar mass of O2 is 31.9988 g/mol
Molar mass of TiO2 is 79.8658 g/mol
Molar mass of C24H26N2O4RuS2[(CH3CH2)3NHCl]2 is 846,97612 g/mol
Molar mass of C2H5OH is 46,06844 g/mol
Molar mass of Co is 58.933195 g/mol
Molar mass of H is 1.00794 g/mol
Molar mass of N2O is 44.0128 g/mol
Molar mass of Ca is +2 g/mol
Molar mass of ca(OH)2 is 74,09268 g/mol
Molar mass of oxygen is 31.9988 g/mol
Molar mass of Co3O4 is 240.797185 g/mol
Molar mass of hydrogen is 2.01588 g/mol
Molar mass of C24H26N2O4RuS2(CH3CH2)3NHCl is 709,32518 g/mol
Molar mass of hydrogen is 2.01588 g/mol
Molar mass of Mo2O3 is 239.9182 g/mol
Molar mass of Mo is 95.96 g/mol
Molar mass of C17H30O2 is 266.4189 g/mol
Molar mass of PbH(OH) is 225.21528 g/mol
Molar mass of Ca(HCO3)2 is 162,11168 g/mol
Molar mass of W is 183.84 g/mol
Molar mass of n2o5 is 108.0104 g/mol
Molar mass of ICH3 is 141.93899 g/mol
Molar mass of WO3 is 231.8382 g/mol
Molar mass of Fe(NO3)3 is 241.8597 g/mol
Molar mass of B2O3 is 69.6202 g/mol
Molar mass of AgNO is 137.8743 g/mol
Molar mass of C24H26N2O4RuS2(CH3CH2)3NHClCH3CH2OH is 755,39362 g/mol
Molar mass of MgCl2 is 95,211 g/mol
Molar mass of B is 10.811 g/mol
Molar mass of Mn is 54.938045 g/mol
Molar mass of C24H26N2O4RuS2(CH3CH2)3NHClH2O is 727,34046 g/mol
Molar mass of NO is 30,0061 g/mol
Molar mass of MnO2 is 86.936845 g/mol
Molar mass of C24H26N2O4RuS2(CH3CH2)3NHCl is 709,32518 g/mol
Molar mass of C6H12O6 is 180.15588 g/mol
Molar mass of Ca(OH)2 is 74.09268 g/mol
Molar mass of O2 is 31.9988 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of SiO2 is 60.0843 g/mol
Molar mass of HCH2CHCO2 is 72.06266 g/mol
Calculate molecular weight
Molecular weights calculated on 11/17/15 | Molecular weights calculated on 11/19/15 |
Molecular masses on 10/19/15
Molecular masses on 11/18/14
Please let us know how we can improve this web app.