Molecular weights calculated on 02/22/15 | Molecular weights calculated on 02/24/15 |
Molar mass of c11h5 is 137.1574 g/mol
Molar mass of c11h12 is 144.21298 g/mol
Molar mass of C4H8O2 is 88.10512 g/mol
Molar mass of CuSO4(H2O)2 is 195.63916 g/mol
Molar mass of c11h11 is 143.20504 g/mol
Molar mass of C4H6O2 is 86.08924 g/mol
Molar mass of CoCl2*6H2O is 237.930875 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of CuSO4 is (H2O)2 g/mol
Molar mass of CH4ON2 is 60.05526 g/mol
Molar mass of Cl is 35.453 g/mol
Molar mass of C6H12O6 is 180.15588 g/mol
Molar mass of Cu2(O2CCH(C6H5)2)1(O2CCH2CH2CH2CH2CH2CH2CH3) is 481.53144 g/mol
Molar mass of La2S3 is 374.00594 g/mol
Molar mass of Cu2(O2CCH(C6H5)2)1(O2CCH2CH2CH2CH2CH2CH2CH3)3 is 767.93844 g/mol
Molar mass of (H2O)2 is 36.03056 g/mol
Molar mass of Fe(ClO3)4 is 389.6498 g/mol
Molar mass of NaF is 41.98817248 g/mol
Molar mass of Al2(SO4)3 is 342.1508772 g/mol
Molar mass of BrH3 is 82.92782 g/mol
Molar mass of Br2 is 159.808 g/mol
Molar mass of CPh4 is 320.4263 g/mol
Molar mass of C8H18 is 114.22852 g/mol
Molar mass of H2C6H6O6 is 176.12412 g/mol
Molar mass of KBr is 119.0023 g/mol
Molar mass of Mg(OH)2 is 58.31968 g/mol
Molar mass of SF6 is 146.0554192 g/mol
Molar mass of o2 is 31.9988 g/mol
Molar mass of O2 is 31.9988 g/mol
Molar mass of Na3N is 82.97600784 g/mol
Molar mass of CH3COOH is 60.05196 g/mol
Molar mass of H2C2O4 is 90.03488 g/mol
Molar mass of O2 is 31.9988 g/mol
Molar mass of O2 is 31.9988 g/mol
Molar mass of NH4Cl is 53.49146 g/mol
Molar mass of NH4Cl is 53.49146 g/mol
Molar mass of CH3CN is 41.05192 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of CH4 is 16.04246 g/mol
Molar mass of CH4 is 16.04246 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of Ba(C2H3O2)2 is 255.41504 g/mol
Molar mass of Cr2O3 is 151.9904 g/mol
Molar mass of Fe(ClO4)3 is 354.1968 g/mol
Molar mass of Fe(ClO4)3 is 354.1968 g/mol
Molar mass of Cl2 is 70.906 g/mol
Molar mass of N2O is 44.0128 g/mol
Molar mass of CaCO3 is 100.0869 g/mol
Molar mass of CuSO4 is 159.6086 g/mol
Calculate molecular weight
Molecular weights calculated on 02/22/15 | Molecular weights calculated on 02/24/15 |
Molecular masses on 01/24/15
Molecular masses on 02/23/14
Please let us know how we can improve this web app.