Molecular weights calculated on 02/22/15 | Molecular weights calculated on 02/24/15 |
Molar mass of c3h802 is 844.39998 g/mol
Molar mass of S is 32.065 g/mol
Molar mass of Na2S2O3 is 158.10773856 g/mol
Molar mass of KI is 166.00277 g/mol
Molar mass of (NH4)2SO4 is 132.13952 g/mol
Molar mass of KCN is 65.1157 g/mol
Molar mass of c3 is 36.0321 g/mol
Molar mass of O is 15.9994 g/mol
Molar mass of al2o3 is 101.9612772 g/mol
Molar mass of Cu(OH)2 is 97.56068 g/mol
Molar mass of KAu(CN)2 is 288.099669 g/mol
Molar mass of carbon is dioxide g/mol
Molar mass of C2H6O is 46.06844 g/mol
Molar mass of c3 is h8 g/mol
Molar mass of c3 is h8 g/mol
Molar mass of K2S is 110.2616 g/mol
Molar mass of C2H6O is 46.06844 g/mol
Molar mass of Zn is 65.38 g/mol
Molar mass of KOH is 56.10564 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of C9H9NO3 is 179.17266 g/mol
Molar mass of CaBr2 is 199.886 g/mol
Molar mass of (Al)2(SO4)3 is 342.1508772 g/mol
Molar mass of Cu(CN)2 is 115.5808 g/mol
Molar mass of methane is 16.04246 g/mol
Molar mass of c3 is h8 g/mol
Molar mass of c3 is h8 g/mol
Molar mass of CH3Br is 94.93852 g/mol
Molar mass of Al2(SO4)3 is 342.1508772 g/mol
Molar mass of Ni(CO)4 is 170.7338 g/mol
Molar mass of CO3 is 60.0089 g/mol
Molar mass of argon is 39.948 g/mol
Molar mass of S is 32.065 g/mol
Molar mass of c3h802 is 844.39998 g/mol
Molar mass of c3h802 is 844.39998 g/mol
Molar mass of K2S is 110.2616 g/mol
Molar mass of KClO3 is 122.5495 g/mol
Molar mass of O2 is 31.9988 g/mol
Molar mass of Mg2(PO4)3 is 333.524086 g/mol
Molar mass of Ca is 40.078 g/mol
Molar mass of AlPO4 is 121.9529006 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of c3h8o2 is 76.09442 g/mol
Molar mass of c3h8o2 is 76.09442 g/mol
Molar mass of CF2 is Cl2 g/mol
Molar mass of BaCO3 is 197.3359 g/mol
Molar mass of Co(NO2)2(H2NCH2CH2NH2)2NO3 is 333.145735 g/mol
Molar mass of Mn(NO3)2(H2O)2 is 214.978405 g/mol
Molar mass of NH3 is 17.03052 g/mol
Calculate molecular weight
Molecular weights calculated on 02/22/15 | Molecular weights calculated on 02/24/15 |
Molecular masses on 01/24/15
Molecular masses on 02/23/14
Please let us know how we can improve this web app.