Molecular weights calculated on 03/06/22 | Molecular weights calculated on 03/08/22 |
Molar mass of Fe(H2O)2Cl4{-} is 233.68810857991 g/mol
Molar mass of CuO is 79.5454 g/mol
Molar mass of H2S04 is 130.27588 g/mol
Molar mass of NaCN is 49.00716928 g/mol
Molar mass of H2SO4 is 98.07848 g/mol
Molar mass of FeCl3 is 162.204 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of Na3PO4 is 163.94066984 g/mol
Molar mass of Bi is 208.9804 g/mol
Molar mass of Na is 22.98976928 g/mol
Molar mass of Al2SO4 is 150.0256772 g/mol
Molar mass of Na3(PO4) is 163.94066984 g/mol
Molar mass of TiO3 is 95.8652 g/mol
Molar mass of H8N2O4S is 132.13952 g/mol
Molar mass of C4H10 is 58.1222 g/mol
Molar mass of C8H18 is 114.22852 g/mol
Molar mass of FeCl2 is 126.751 g/mol
Molar mass of (NH4)2HPO4 is 132.056222 g/mol
Molar mass of H3PO4 is 97.995182 g/mol
Molar mass of H2S is 34.08088 g/mol
Molar mass of CuSO4 is 159.6086 g/mol
Molar mass of Na2SO4 is 142.04213856 g/mol
Molar mass of CuSO4*5H2o is 249.685 g/mol
Molar mass of C20H17N6F3 is 398.3843896 g/mol
Molar mass of Pb(OH) is CI g/mol
Molar mass of C20H17N6F3Na is 421.37415888 g/mol
Molar mass of NaF is 41.98817248 g/mol
Molar mass of C6H12O6 is 180.15588 g/mol
Molar mass of Mn(OH) is S g/mol
Molar mass of Co2(C6H2N2O6)2(C7H7NO)2 is 756.31931 g/mol
Molar mass of U(OH) is 2Te2 g/mol
Molar mass of C is 12.0107 g/mol
Molar mass of CH3COONa is 82.03378928 g/mol
Molar mass of Sn(OH) is 2Se g/mol
Molar mass of C2H5OH is 46.06844 g/mol
Molar mass of Ni(OH) is Se g/mol
Molar mass of Co2(C6H2N2O6)2(C7H7NO)2(H2O) is 774.33459 g/mol
Molar mass of CuO*5H2O is 169.6218 g/mol
Molar mass of Mg(NO3)2 is 148.3148 g/mol
Molar mass of C21H15B13O12 is 599.8796 g/mol
Molar mass of CaCOOH is 85.09544 g/mol
Molar mass of Na2CO3 is 105.98843856 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of Ca(C2O2H3)2 is 158.16604 g/mol
Molar mass of C9H11NO2 is 165.18914 g/mol
Molar mass of C9H8O4 is 180.15742 g/mol
Molar mass of CuCl2*2H2o is 170.48256 g/mol
Molar mass of Na2NO3 is 107.98443856 g/mol
Molar mass of Ca(C2O2H3)2*H2O is 176.18132 g/mol
Calculate molecular weight
Molecular weights calculated on 03/06/22 | Molecular weights calculated on 03/08/22 |
Molecular masses on 02/05/22
Molecular masses on 03/07/21
Please let us know how we can improve this web app.