| Molecular weights calculated on 05/12/21 | Molecular weights calculated on 05/14/21 |
Molar mass of Y2(SO4)3(H2O)8 is 610.12174 g/mol
Molar mass of Ni(C12H8N2)(C4NO2SCl2)2(H2O)2 is 668.96788 g/mol
Molar mass of C3032 is 36416.4424 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of CuSO4 is 159.6086 g/mol
Molar mass of h2so4 is 98.07848 g/mol
Molar mass of (Ni(C12H8N2)(C4NO2SCl2)2)2(H2O)3 is 1319.92048 g/mol
Molar mass of NO2 is 46.0055 g/mol
Molar mass of Al2(CO3)3 is 233.9897772 g/mol
Molar mass of KMnO4 is 158.033945 g/mol
Molar mass of Ce1Y2Fe5O12 is 789.1455 g/mol
Molar mass of CaH2 is 42.09388 g/mol
Molar mass of Y3Fe5O12 is 737.93535 g/mol
Molar mass of Mg is 24.305 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of so3 is 80.0632 g/mol
Calculate molecular weight
| Molecular weights calculated on 05/12/21 | Molecular weights calculated on 05/14/21 |
Molecular masses on 04/13/21
Molecular masses on 05/13/20
Please let us know how we can improve this web app.
