Molecular weights calculated on 05/05/21 | Molecular weights calculated on 05/07/21 |
Molar mass of MgSO4*7H2o is 246.47456 g/mol
Molar mass of KNO3 is 101.1032 g/mol
Molar mass of C14H20NO is 218.3147 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of h2 is 2.01588 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of magnesium is sulfate g/mol
Molar mass of FeO is 71.8444 g/mol
Molar mass of NaHCO3 is 84.00660928 g/mol
Molar mass of H2SO4 is 98.07848 g/mol
Molar mass of C4H10CO is 86.1323 g/mol
Molar mass of C4H10CO is 86.1323 g/mol
Molar mass of C12H22N2O is 210.31588 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of AlH3 is 30.0053586 g/mol
Molar mass of nh3 is 17.03052 g/mol
Molar mass of Fe2 is O2 g/mol
Molar mass of Cs2CO3 is 325.8198038 g/mol
Molar mass of NaNO3 is 84.99466928 g/mol
Molar mass of calcium is carbonate g/mol
Molar mass of C14H22N2O is 234.33728 g/mol
Molar mass of CH3CH2OH is 46.06844 g/mol
Molar mass of o2 is 31.9988 g/mol
Molar mass of Cu(C10H8N2S2)(C8H14O2)2(H2O)2 is 604.2816 g/mol
Molar mass of Li3S is 52.888 g/mol
Molar mass of Na2SeO3 is 172.93773856 g/mol
Molar mass of Na2SO4 is 142.04213856 g/mol
Molar mass of K2Cr2O7 is 294.1846 g/mol
Molar mass of c7h5n3o6 is 227.1311 g/mol
Molar mass of CaF2 is 78.0748064 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of S is 32.065 g/mol
Molar mass of Fe2O3 is 159.6882 g/mol
Molar mass of FeSO4 is 151.9076 g/mol
Molar mass of Na3N is 82.97600784 g/mol
Molar mass of Al2(SO4)3 is 342.1508772 g/mol
Molar mass of Fe(NO2)3 is 193.8615 g/mol
Molar mass of H3BO3 is 61.83302 g/mol
Molar mass of NH4Cl is 53.49146 g/mol
Molar mass of KMnO4 is 158.033945 g/mol
Molar mass of H2CO3 is 62.02478 g/mol
Molar mass of CuSO4 is 159.6086 g/mol
Molar mass of CaCO3 is 100.0869 g/mol
Molar mass of CuSO4 is 159.6086 g/mol
Molar mass of NaHCO3 is 84.00660928 g/mol
Molar mass of phosphorus is trichloride g/mol
Molar mass of Cl2 is 70.906 g/mol
Molar mass of C5H10O2 is 102.1317 g/mol
Molar mass of c6h14 is 86.17536 g/mol
Calculate molecular weight
Molecular weights calculated on 05/05/21 | Molecular weights calculated on 05/07/21 |
Molecular masses on 04/06/21
Molecular masses on 05/06/20
Please let us know how we can improve this web app.