Molecular weights calculated on 04/13/21 | Molecular weights calculated on 04/15/21 |
Molar mass of Au2O is 409.932538 g/mol
Molar mass of Pt is (OH)4 g/mol
Molar mass of NO2 is 46.0055 g/mol
Molar mass of (NH4)2SO4 is 132.13952 g/mol
Molar mass of BI(NO3) is 199.72037 g/mol
Molar mass of BI(NO3) is 199.72037 g/mol
Molar mass of Al2O3 is 101.9612772 g/mol
Molar mass of ca is 40.078 g/mol
Molar mass of Na is (OH) g/mol
Molar mass of hydrogen is 2.01588 g/mol
Molar mass of CS is 132.9054519 g/mol
Molar mass of CuSO4 is 159.6086 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of Sn is 118.71 g/mol
Molar mass of PtO2 is 227.0828 g/mol
Molar mass of K is (OH) g/mol
Molar mass of KMnO4 is 158.033945 g/mol
Molar mass of AlCl3 is 133.3405386 g/mol
Molar mass of Al is 26.9815386 g/mol
Molar mass of AgH is 108.87614 g/mol
Molar mass of (CaSO42H2O) is 762.13308 g/mol
Molar mass of Na2SO4 is 142.04213856 g/mol
Molar mass of C2H5OH is 46.06844 g/mol
Molar mass of Ti is 47.867 g/mol
Molar mass of C18H27NO3 is 305.41188 g/mol
Molar mass of H2S is 34.08088 g/mol
Molar mass of O2 is 31.9988 g/mol
Molar mass of BI(NO3)3 is 323.73017 g/mol
Molar mass of FeCI3 is 448.56911 g/mol
Molar mass of (H2O)(CO)(CO) is 74.03548 g/mol
Molar mass of ZnH2 is 67.39588 g/mol
Molar mass of NaAc is 250.01752138 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of (CaSO4 is 2H2O) g/mol
Molar mass of AgNO3 is 169.8731 g/mol
Molar mass of AlF3 is 83.9767482 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of SiH4 is 32.11726 g/mol
Molar mass of MnCl2*4H2O is 197.905165 g/mol
Molar mass of Fe is 55.845 g/mol
Molar mass of Bi(NO3)3 is 394.9951 g/mol
Molar mass of CH3COOH is 60.05196 g/mol
Molar mass of (CaSO4 is 2H2O) g/mol
Molar mass of CH3COONa is 82.03378928 g/mol
Molar mass of water is 18.01528 g/mol
Molar mass of nacl is 58.44276928 g/mol
Molar mass of H2Se is 80.97588 g/mol
Molar mass of NaCH3CO2 is 82.03378928 g/mol
Molar mass of CH3CH2CH2CH2C(O)CH2CH2CH2CH2CH3 is 156.2652 g/mol
Calculate molecular weight
Molecular weights calculated on 04/13/21 | Molecular weights calculated on 04/15/21 |
Molecular masses on 03/15/21
Molecular masses on 04/14/20
Please let us know how we can improve this web app.