Molecular weights calculated on 04/07/21 | Molecular weights calculated on 04/09/21 |
Molar mass of (Fe)3O4 is 231.5326 g/mol
Molar mass of MnO2 is 86.936845 g/mol
Molar mass of C956H1152N113O135BS20Cl7Br3IF14P3 is 18011.8495808 g/mol
Molar mass of (HO2CCH2)2NCH2CH2N(CH2CO2H)2 is 292.24264 g/mol
Molar mass of O2 is 31.9988 g/mol
Molar mass of He is 4.002602 g/mol
Molar mass of (HO2CCH2)2NCH2CH2N(CH2CO2H)2FeHO2 is 381.09438 g/mol
Molar mass of H16 is 16.12704 g/mol
Molar mass of H16 is 16.12704 g/mol
Molar mass of Al2O3 is 101.9612772 g/mol
Molar mass of C2H5OH is 46.06844 g/mol
Molar mass of hcl is 36.46094 g/mol
Molar mass of Fe2O3 is 159.6882 g/mol
Molar mass of H6C4 is 54.09044 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of NH4NO2 is 64.04396 g/mol
Molar mass of C6H12O6 is 180.15588 g/mol
Molar mass of Al2(CO3)3 is 233.9897772 g/mol
Molar mass of NH4NO3 is 80.04336 g/mol
Molar mass of Ca(NO3)2 is 164.0878 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of Cl2 is 70.906 g/mol
Molar mass of ZnCO3 is 125.3889 g/mol
Molar mass of co2 is 44.0095 g/mol
Molar mass of Al is 26.9815386 g/mol
Molar mass of Cl2si2 is 127.077 g/mol
Molar mass of Na2(HO2CCH2)2NCH2CH2N(CH2CO2H)2FeHO2N2 is 455.08731856 g/mol
Molar mass of NaHCO3 is 84.00660928 g/mol
Molar mass of Cl2si2H2 is 129.09288 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of H2VO4 is 116.95498 g/mol
Molar mass of Ba3(PO4)2 is 601.923724 g/mol
Molar mass of (nh4)2so4 is 132.13952 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of MgI2 is 278.11394 g/mol
Molar mass of Li3N is 34.8297 g/mol
Molar mass of (NH4)2SO4 is 132.13952 g/mol
Molar mass of O4H3P is 97.995182 g/mol
Molar mass of CuSO4 is 159.6086 g/mol
Molar mass of Fe3O4 is 231.5326 g/mol
Molar mass of Ca3(PO4)2 is 310.176724 g/mol
Molar mass of Cl2C2H4 is 98.95916 g/mol
Molar mass of k20 is 781.966 g/mol
Molar mass of CH3 is 15.03452 g/mol
Molar mass of C12H22O11 is 342.29648 g/mol
Molar mass of K2SO4 is 174.2592 g/mol
Molar mass of Cr3O4 is 219.9859 g/mol
Molar mass of C3Br6 is 515.4561 g/mol
Molar mass of n2 is 28.0134 g/mol
Calculate molecular weight
Molecular weights calculated on 04/07/21 | Molecular weights calculated on 04/09/21 |
Molecular masses on 03/09/21
Molecular masses on 04/08/20
Please let us know how we can improve this web app.