| Molecular weights calculated on 03/24/21 | Molecular weights calculated on 03/26/21 |
Molar mass of Cu2(C14H12N2)(C7H5N4)4(H2O)2 is 951.94664 g/mol
Molar mass of HCLO3 is 84.45914 g/mol
Molar mass of Cu2(C14H12N2)(C7H5N4)4(C2H5OH)2 is 1008.05296 g/mol
Molar mass of carbon is dioxide g/mol
Molar mass of O(NH4)2 is 52.07632 g/mol
Molar mass of Sodium is chloride g/mol
Molar mass of Na is 22.98976928 g/mol
Molar mass of Lu2O3 is 397.9318 g/mol
Molar mass of Lu2O3 is 397.9318 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of hcl is 36.46094 g/mol
Molar mass of KOH is 56.10564 g/mol
Molar mass of HClO2 is 68.45974 g/mol
Molar mass of Cl is 35.453 g/mol
Molar mass of N2S2 is 92.1434 g/mol
Molar mass of C6H12O6 is 180.15588 g/mol
Molar mass of (NH4)3PO4 is 149.086742 g/mol
Molar mass of C6 is 72.0642 g/mol
Molar mass of N3 is 42.0201 g/mol
Molar mass of H7 is 7.05558 g/mol
Molar mass of C2H5OH is 46.06844 g/mol
Molar mass of P2O5 is 141.944524 g/mol
Molar mass of NaO6 is 118.98616928 g/mol
Molar mass of H2 is SO2 g/mol
Molar mass of P2O5 is 141.944524 g/mol
Molar mass of H12 is 12.09528 g/mol
Molar mass of Na2CO3 is 105.98843856 g/mol
Molar mass of P is 30.973762 g/mol
Molar mass of NaH is 23.99770928 g/mol
Molar mass of calcium is hydroxide g/mol
Molar mass of O4 is 63.9976 g/mol
Molar mass of N2S2 is 92.1434 g/mol
Molar mass of N2S2 is 92.1434 g/mol
Molar mass of N2S2 is 92.1434 g/mol
Molar mass of nh3 is 17.03052 g/mol
Molar mass of KMnO4 is 158.033945 g/mol
Molar mass of Ca(H2PO4)2 is 234.052484 g/mol
Molar mass of hCl is 36.46094 g/mol
Molar mass of P is 30.973762 g/mol
Molar mass of H2 is SO4 g/mol
Molar mass of al2 is 53.9630772 g/mol
Molar mass of CaCl2 is 110.984 g/mol
Molar mass of H12 is 12.09528 g/mol
Molar mass of Ba(NO3)2 is 261.3368 g/mol
Molar mass of H is 1.00794 g/mol
Molar mass of C24H8F16 is 600.2947712 g/mol
Molar mass of C24H8F16 is 600.2947712 g/mol
Molar mass of H2SO3 is 82.07908 g/mol
Molar mass of C2H4 is 28.05316 g/mol
Calculate molecular weight
| Molecular weights calculated on 03/24/21 | Molecular weights calculated on 03/26/21 |
Molecular masses on 02/23/21
Molecular masses on 03/25/20
Please let us know how we can improve this web app.
