| Molecular weights calculated on 03/22/21 | Molecular weights calculated on 03/24/21 |
Molar mass of C6h6 is 78.11184 g/mol
Molar mass of O is 15.9994 g/mol
Molar mass of Cu2(SO4)2 is 319.2172 g/mol
Molar mass of LvPbO2 is 239.1988 g/mol
Molar mass of C4 is H9 g/mol
Molar mass of H2CO3 is 62.02478 g/mol
Molar mass of HCI is 139.92311 g/mol
Molar mass of NH4NO3 is 80.04336 g/mol
Molar mass of PH3 is 33.997582 g/mol
Molar mass of C is 12.0107 g/mol
Molar mass of PH4 is 35.005522 g/mol
Molar mass of C is 12.0107 g/mol
Molar mass of na2co3 is 105.98843856 g/mol
Molar mass of PH3 is 33.997582 g/mol
Molar mass of F is 18.9984032 g/mol
Molar mass of CaCo is 99.011195 g/mol
Molar mass of NaClO3 is 106.44096928 g/mol
Molar mass of Al(NO3)3 is 212.9962386 g/mol
Molar mass of F2 is 37.9968064 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of Ca(OH)2 is 74.09268 g/mol
Molar mass of C6H12O6 is 180.15588 g/mol
Molar mass of C2H5OH is 46.06844 g/mol
Molar mass of CF4 is 88.0043128 g/mol
Molar mass of Na2ClO3 is 129.43073856 g/mol
Molar mass of chlorine is 70.906 g/mol
Molar mass of CH3O(CH2CH2O)200CH2CH2COH is 8898.61712 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of C2H5OH is 46.06844 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of (NH4)2SO4 is 132.13952 g/mol
Molar mass of N is 14.0067 g/mol
Molar mass of cu is 63.546 g/mol
Molar mass of C12H22O11 is 342.29648 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of ca2o2 is 112.1548 g/mol
Molar mass of CaCl2 is 110.984 g/mol
Molar mass of SO2 is 64.0638 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of Na2CO3 is 105.98843856 g/mol
Molar mass of Mg(OH)2 is 58.31968 g/mol
Molar mass of oxygen is 31.9988 g/mol
Molar mass of (C2H5)2NH2Cl is 109.59778 g/mol
Molar mass of O is 15.9994 g/mol
Molar mass of MgO is 40.3044 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Calculate molecular weight
| Molecular weights calculated on 03/22/21 | Molecular weights calculated on 03/24/21 |
Molecular masses on 02/21/21
Molecular masses on 03/23/20
Please let us know how we can improve this web app.
