Molecular weights calculated on 03/21/21 | Molecular weights calculated on 03/23/21 |
Molar mass of Fe is 55.845 g/mol
Molar mass of C7N5NO3S4 is 344.3733 g/mol
Molar mass of KClO3 is 122.5495 g/mol
Molar mass of NH4MgPO3 is 121.315422 g/mol
Molar mass of Co(NH3)5(h2o)(no3)3 is 2494.010345 g/mol
Molar mass of CH3(CH2)4CHCHCH2CHCH(CH2)7COOH is 280.44548 g/mol
Molar mass of (NH4)2S is 68.14192 g/mol
Molar mass of KOH is 56.10564 g/mol
Molar mass of N2O is 44.0128 g/mol
Molar mass of SO2 is 64.0638 g/mol
Molar mass of MgSO4 is 120.3676 g/mol
Molar mass of Co(NH3)5(h2o)(no3)3 is 2494.010345 g/mol
Molar mass of H10O11 is 186.0728 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of KAl(SO4)2 is 258.2050386 g/mol
Molar mass of glycine is 75.0666 g/mol
Molar mass of NO is 30.0061 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of KMnO4 is 158.033945 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of As is 74.9216 g/mol
Molar mass of N2 is 28.0134 g/mol
Molar mass of KClO3 is 122.5495 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of H2O2 is 34.01468 g/mol
Molar mass of CrF3 is 108.9913096 g/mol
Molar mass of HgBr2 is 360.398 g/mol
Molar mass of Pb2CuCrO4AsO4OH is 749.86624 g/mol
Molar mass of Ca(ClO₄)₂ is 238.9792 g/mol
Molar mass of N2O5 is 108.0104 g/mol
Molar mass of Na3PO4 is 163.94066984 g/mol
Molar mass of Cu is 63.546 g/mol
Molar mass of C12H22O11 is 342.29648 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of CrCl3 is 158.3551 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of MgO is 40.3044 g/mol
Molar mass of Co(PO4)2 is 248.875919 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of Fe2(CO3) is 171.6989 g/mol
Molar mass of Eu(OH)3 is 202.98602 g/mol
Molar mass of In4(P2O7)3 is 981.101972 g/mol
Molar mass of Co is 28.0101 g/mol
Molar mass of (NO3)3Au is 382.981269 g/mol
Molar mass of NH4OH is 35.0458 g/mol
Molar mass of h is 1.00794 g/mol
Molar mass of H20 is 20.1588 g/mol
Molar mass of Al(NO3)3 is 212.9962386 g/mol
Calculate molecular weight
Molecular weights calculated on 03/21/21 | Molecular weights calculated on 03/23/21 |
Molecular masses on 02/20/21
Molecular masses on 03/22/20
Please let us know how we can improve this web app.