Molecular weights calculated on 02/14/21 | Molecular weights calculated on 02/16/21 |
Molar mass of Na is 22.98976928 g/mol
Molar mass of C20H42O is 298.54688 g/mol
Molar mass of MgCO3 is 84.3139 g/mol
Molar mass of H2SO4 is 98.07848 g/mol
Molar mass of C17H32O2 is 268.43478 g/mol
Molar mass of H2SO4 is 98.07848 g/mol
Molar mass of C4H16O4Si4 is 240.50944 g/mol
Molar mass of CH3COOH is 60.05196 g/mol
Molar mass of Al2O3 is 101.9612772 g/mol
Molar mass of C6 is H12 g/mol
Molar mass of C82H123N24O2B80InPd4S8(H2O)15(C2B10H11S)2 is 3759.7083 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of Fe(OH)3 is 106.86702 g/mol
Molar mass of Sodium is carbonate g/mol
Molar mass of C82H123N24O2B80InPd4S8(H2O)10(C2B10H11S)2 is 3669.6319 g/mol
Molar mass of c31h34o11 is 582.59506 g/mol
Molar mass of C21H42O2 is 326.55698 g/mol
Molar mass of Al is 26.9815386 g/mol
Molar mass of C16H30O is 238.4088 g/mol
Molar mass of Na2SO4 is 142.04213856 g/mol
Molar mass of water is 18.01528 g/mol
Molar mass of Sodium is carbonate g/mol
Molar mass of C19H38O2 is 298.50382 g/mol
Molar mass of H is 1.00794 g/mol
Molar mass of Cs4P2O7 is 705.5651316 g/mol
Molar mass of Na is 22.98976928 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of H2SO4 is 98.07848 g/mol
Molar mass of ZnCO3 is 125.3889 g/mol
Molar mass of Na2SO4 is 142.04213856 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of hcl is 36.46094 g/mol
Molar mass of Na is 22.98976928 g/mol
Molar mass of H2SO4 is 98.07848 g/mol
Molar mass of C2H2 is 26.03728 g/mol
Molar mass of K2C2O4*H2O is 184.23088 g/mol
Molar mass of NCl3 is 120.3657 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of cl2 is 70.906 g/mol
Molar mass of Al(OH)3 is 78.0035586 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of AlPO4 is 121.9529006 g/mol
Molar mass of Al(OH)3 is 78.0035586 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of NH4 is 18.03846 g/mol
Molar mass of H2S is 34.08088 g/mol
Molar mass of H2SO4 is 98.07848 g/mol
Molar mass of CH3COOH is 60.05196 g/mol
Molar mass of Cr is 51.9961 g/mol
Calculate molecular weight
Molecular weights calculated on 02/14/21 | Molecular weights calculated on 02/16/21 |
Molecular masses on 01/16/21
Molecular masses on 02/15/20
Please let us know how we can improve this web app.