Molecular weights calculated on 01/31/21 | Molecular weights calculated on 02/02/21 |
Molar mass of C12H22011 is 22329.89574 g/mol
Molar mass of CHCl3 is 119.37764 g/mol
Molar mass of NaClO3 is 106.44096928 g/mol
Molar mass of C12H22o11 is 342.29648 g/mol
Molar mass of hydrochloric is acid g/mol
Molar mass of h2o is 18.01528 g/mol
Molar mass of hydrochloric is acid g/mol
Molar mass of aluminium is 26.9815386 g/mol
Molar mass of N2S2 is 92.1434 g/mol
Molar mass of CCl4 is 153.8227 g/mol
Molar mass of glucose is 180.15588 g/mol
Molar mass of c15h14o2n is 240.27716 g/mol
Molar mass of NaHCO3 is 84.00660928 g/mol
Molar mass of silver is nitrate g/mol
Molar mass of naoh is 39.99710928 g/mol
Molar mass of C47 is 564.5029 g/mol
Molar mass of C3H10NO is 76.1176 g/mol
Molar mass of KAl(SO4)2 is 258.2050386 g/mol
Molar mass of silver is chloride g/mol
Molar mass of C3H9NO is 75.10966 g/mol
Molar mass of C48 is 576.5136 g/mol
Molar mass of Ca(OH)2 is 74.09268 g/mol
Molar mass of HBr is 80.91194 g/mol
Molar mass of H5ON is 35.0458 g/mol
Molar mass of NaBr is 102.89376928 g/mol
Molar mass of C12 is h15 g/mol
Molar mass of Pb(NO3)2 is 331.2098 g/mol
Molar mass of C10h15 is 135.2261 g/mol
Molar mass of Na2o is 61.97893856 g/mol
Molar mass of C6h15 is 87.1833 g/mol
Molar mass of (C2H5)2NH2Br is 154.04878 g/mol
Molar mass of C8h15 is 111.2047 g/mol
Molar mass of C7h15 is 99.194 g/mol
Molar mass of C7h13 is 97.17812 g/mol
Molar mass of Ba2Ca18(SiO4)6(PO4)3(CO3)F3O is 1966.4741956 g/mol
Molar mass of CaF2 is 78.0748064 g/mol
Molar mass of C7h20 is 104.2337 g/mol
Molar mass of Na2CO3 is 105.98843856 g/mol
Molar mass of C7h22 is 106.24958 g/mol
Molar mass of C7h23 is 107.25752 g/mol
Molar mass of C7h24 is 108.26546 g/mol
Molar mass of K2CrO4 is 194.1903 g/mol
Molar mass of sucrose is 342.29648 g/mol
Molar mass of neon is 20.1797 g/mol
Molar mass of C49 is 588.5243 g/mol
Molar mass of K3PO4 is 212.266262 g/mol
Molar mass of Cr2(C2O4)3 is 368.0492 g/mol
Molar mass of P2O5 is 141.944524 g/mol
Molar mass of C50 is 600.535 g/mol
Calculate molecular weight
Molecular weights calculated on 01/31/21 | Molecular weights calculated on 02/02/21 |
Molecular masses on 01/02/21
Molecular masses on 02/01/20
Please let us know how we can improve this web app.