Molecular weights calculated on 01/28/21 | Molecular weights calculated on 01/30/21 |
Molar mass of MnO2 is 86.936845 g/mol
Molar mass of MnCl2 is 125.844045 g/mol
Molar mass of BaOH2 is 155.34228 g/mol
Molar mass of C3H15N3O6 is 189.1677 g/mol
Molar mass of C2H6 is 30.06904 g/mol
Molar mass of KOH is 56.10564 g/mol
Molar mass of NH4Cl is 53.49146 g/mol
Molar mass of KOH is 56.10564 g/mol
Molar mass of K2CO3 is 138.2055 g/mol
Molar mass of NaNO3 is 84.99466928 g/mol
Molar mass of Na is 22.98976928 g/mol
Molar mass of C6H12O6 is 180.15588 g/mol
Molar mass of Na is 22.98976928 g/mol
Molar mass of Fe2(SO3)3 is 351.8796 g/mol
Molar mass of propanol is 60.09502 g/mol
Molar mass of CH2C(CH3)CONH(CH2)3N(CH3)3Cl is 220.73954 g/mol
Molar mass of Kno3 is 101.1032 g/mol
Molar mass of Pb(N2O5)2 is 423.2208 g/mol
Molar mass of Al2(SO4)3 is 342.1508772 g/mol
Molar mass of CuSO4 is 159.6086 g/mol
Molar mass of (NH4)3PO4 is 149.086742 g/mol
Molar mass of FeSO4 is 151.9076 g/mol
Molar mass of Na2CrO4 is 161.97323856 g/mol
Molar mass of Zr is 91.224 g/mol
Molar mass of MoO3 is 143.9582 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of XeO4 is 195.2906 g/mol
Molar mass of Ba2 is 274.654 g/mol
Molar mass of SnCl2 is 189.616 g/mol
Molar mass of SnCl2 is 189.616 g/mol
Molar mass of MgCO3 is 84.3139 g/mol
Molar mass of Ca3PO43 is 839.181962 g/mol
Molar mass of CH2C(CH3)CO2CH2CH2O is 2P(O)OH g/mol
Molar mass of S8 is 256.52 g/mol
Molar mass of Ca3(PO4)3 is 405.148086 g/mol
Molar mass of CH2C(CH3)CO2CH2CH2O*2P(O)OH is 257.094864 g/mol
Molar mass of NH4CL is 53.49146 g/mol
Molar mass of (NH4) is 2SO4 g/mol
Molar mass of (CH2C(CH3)CO2CH2CH2O)2P(O)OH is 322.248222 g/mol
Molar mass of Ni2O3 is 165.385 g/mol
Molar mass of Mg(HCO3)2 is 146.33868 g/mol
Molar mass of H2SO4 is 98.07848 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of SnCl2 is 189.616 g/mol
Molar mass of HClO is 52.46034 g/mol
Molar mass of Ca(OH)2 is 74.09268 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of C3H8 is 44.09562 g/mol
Molar mass of HBr is 80.91194 g/mol
Calculate molecular weight
Molecular weights calculated on 01/28/21 | Molecular weights calculated on 01/30/21 |
Molecular masses on 12/30/20
Molecular masses on 01/29/20
Please let us know how we can improve this web app.