Molecular weights calculated on 01/27/21 | Molecular weights calculated on 01/29/21 |
Molar mass of Mg(C2H5COO)2 is 170.4462 g/mol
Molar mass of K3P is 148.268662 g/mol
Molar mass of K is 39.0983 g/mol
Molar mass of Fe2O3 is 159.6882 g/mol
Molar mass of HHHC is CH2 g/mol
Molar mass of Cu is 63.546 g/mol
Molar mass of C6H12O6 is 180.15588 g/mol
Molar mass of Mg(OH)2 is 58.31968 g/mol
Molar mass of K2Cr2O7 is 294.1846 g/mol
Molar mass of *Ba3(PO4)1 is 506.952362 g/mol
Molar mass of O2 is 31.9988 g/mol
Molar mass of CrH24KO20S2 is 499.40296 g/mol
Molar mass of Fe2O3 is 159.6882 g/mol
Molar mass of *Ba3(PO4)2 is 601.923724 g/mol
Molar mass of H2SO3 is 82.07908 g/mol
Molar mass of Al2S3 is 150.1580772 g/mol
Molar mass of H2SO3 is 82.07908 g/mol
Molar mass of ZnS is 97.445 g/mol
Molar mass of C4H6O is 70.08984 g/mol
Molar mass of k is 39.0983 g/mol
Molar mass of BaCrO4 is 253.3207 g/mol
Molar mass of H3P04 is 126.918868 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of C3H5O3Na3 is 158.03930784 g/mol
Molar mass of HHHCCCH2 is 41.0718 g/mol
Molar mass of Na3N is 82.97600784 g/mol
Molar mass of H3PO4 is 97.995182 g/mol
Molar mass of K2Cr2O7 is 294.1846 g/mol
Molar mass of Ti is 47.867 g/mol
Molar mass of NaNO3 is 84.99466928 g/mol
Molar mass of Cr2S3 is 200.1872 g/mol
Molar mass of c9 is 108.0963 g/mol
Molar mass of LiOH is 23.94834 g/mol
Molar mass of Ti is 47.867 g/mol
Molar mass of CO is 28.0101 g/mol
Molar mass of C6H12O6 is 180.15588 g/mol
Molar mass of C6H12O6 is 180.15588 g/mol
Molar mass of C6H3(CH3)2NHCOCH2N(C2H5)2 is 234.33728 g/mol
Molar mass of (PO4)2 is 189.942724 g/mol
Molar mass of KOH is 56.10564 g/mol
Molar mass of FeO is 71.8444 g/mol
Molar mass of h8 is 8.06352 g/mol
Molar mass of C13H16N3NaO4S is 333.33860928 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of C7H16 is 100.20194 g/mol
Molar mass of o4 is 63.9976 g/mol
Molar mass of Al4C3 is 143.9582544 g/mol
Molar mass of CaSO4 is 136.1406 g/mol
Molar mass of Na is 22.98976928 g/mol
Calculate molecular weight
Molecular weights calculated on 01/27/21 | Molecular weights calculated on 01/29/21 |
Molecular masses on 12/29/20
Molecular masses on 01/28/20
Please let us know how we can improve this web app.