Molecular weights calculated on 01/19/21 | Molecular weights calculated on 01/21/21 |
Molar mass of N is 14.0067 g/mol
Molar mass of Ba is 137.327 g/mol
Molar mass of Ba is 137.327 g/mol
Molar mass of C12H22FeO14 is 446.13968 g/mol
Molar mass of (NH4)2S2O8 is 228.20212 g/mol
Molar mass of NaHCO3 is 84.00660928 g/mol
Molar mass of sodium is chloride g/mol
Molar mass of C6H6 is 78.11184 g/mol
Molar mass of CHCl3 is 119.37764 g/mol
Molar mass of C6H3(OH)3 is 126.11004 g/mol
Molar mass of Fe2O3 is 159.6882 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of Br2 is 159.808 g/mol
Molar mass of SO2 is 64.0638 g/mol
Molar mass of Mn(CIO3)2 is 428.764785 g/mol
Molar mass of C11 is 132.1177 g/mol
Molar mass of Al is 26.9815386 g/mol
Molar mass of calcium is carbonate g/mol
Molar mass of CH3COCH3 is 58.07914 g/mol
Molar mass of *2CO2 is 88.019 g/mol
Molar mass of Al2(SO4)3 is 342.1508772 g/mol
Molar mass of C8H18 is 114.22852 g/mol
Molar mass of H3PO4 is 97.995182 g/mol
Molar mass of MgO is 40.3044 g/mol
Molar mass of H2SO4 is 98.07848 g/mol
Molar mass of AlCl3 is 133.3405386 g/mol
Molar mass of KBr is 119.0023 g/mol
Molar mass of C6H12O6(CH3CH2)2OCH3CSNH2 is 329.41028 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of Ba(NO3)2 is 261.3368 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of *4H2SO4 is 392.31392 g/mol
Molar mass of O is 15.9994 g/mol
Molar mass of O4 is 63.9976 g/mol
Molar mass of CaC4H4O6 is 188.14896 g/mol
Molar mass of s2 is 64.13 g/mol
Molar mass of CHCI3 is 405.74275 g/mol
Molar mass of NO is 30.0061 g/mol
Molar mass of NO is 30.0061 g/mol
Molar mass of o8 is 127.9952 g/mol
Molar mass of Li2SO4 is 109.9446 g/mol
Molar mass of Mg(HCO3)2 is 146.33868 g/mol
Molar mass of CH3OH is 32.04186 g/mol
Molar mass of c3h6o is 58.07914 g/mol
Molar mass of F2N4 is 94.0236064 g/mol
Molar mass of C5H12 is 72.14878 g/mol
Molar mass of O is 15.9994 g/mol
Molar mass of Mg3Si4O10(OH)2(talc) is 379.26568 g/mol
Calculate molecular weight
Molecular weights calculated on 01/19/21 | Molecular weights calculated on 01/21/21 |
Molecular masses on 12/21/20
Molecular masses on 01/20/20
Please let us know how we can improve this web app.