Molecular weights calculated on 12/16/20 | Molecular weights calculated on 12/18/20 |
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of MGSO4 is 120.3676 g/mol
Molar mass of Pb(OH)2 is 241.21468 g/mol
Molar mass of Fe2S3 is 207.885 g/mol
Molar mass of Fe2S3 is 207.885 g/mol
Molar mass of Al2(SO4)3 is 342.1508772 g/mol
Molar mass of Al(NO3)3 is 212.9962386 g/mol
Molar mass of CH3(CH2)10CH2(OCH2CH2)nOSO3Na is 346.43852928 g/mol
Molar mass of Fe2O3 is 159.6882 g/mol
Molar mass of SiBr4 is 347.7015 g/mol
Molar mass of ammonia is 17.03052 g/mol
Molar mass of Mg3(PO4)2 is 262.857724 g/mol
Molar mass of (N is h4)3PO4 g/mol
Molar mass of PbI2 is 461.00894 g/mol
Molar mass of Al2(SO4)3 is 342.1508772 g/mol
Molar mass of P3Cl is 128.374286 g/mol
Molar mass of NH4NO3 is 80.04336 g/mol
Molar mass of P2Cl3 is 168.306524 g/mol
Molar mass of naoh is 39.99710928 g/mol
Molar mass of Al(CN)3 is 105.0337386 g/mol
Molar mass of MnO2 is 86.936845 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of PCl3 is 137.332762 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of PCl is 66.426762 g/mol
Molar mass of C2H8N2 is 60.09832 g/mol
Molar mass of Ar is 39.948 g/mol
Molar mass of ammonia is 17.03052 g/mol
Molar mass of C5H12 is 72.14878 g/mol
Molar mass of hydrogen is 2.01588 g/mol
Molar mass of Na2O is 61.97893856 g/mol
Molar mass of Silver is 107.8682 g/mol
Molar mass of Ca(OH)2 is 74.09268 g/mol
Molar mass of AlCl3 is 133.3405386 g/mol
Molar mass of CuNO2 is 109.5515 g/mol
Molar mass of Ca(NO3)2 is 164.0878 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of sodium is sulfate g/mol
Molar mass of O2 is 31.9988 g/mol
Molar mass of SiBr4 is 347.7015 g/mol
Molar mass of CaCrO4 is 156.0717 g/mol
Molar mass of Cl2 is 70.906 g/mol
Molar mass of Na2CO3 is 105.98843856 g/mol
Molar mass of Mgcl2 is 95.211 g/mol
Molar mass of Ca(NO is 3 g/mol
Molar mass of MgCl2 is 95.211 g/mol
Molar mass of [Co(NH3)6]Cl3 is 267.475315 g/mol
Molar mass of P3CI is 231.836456 g/mol
Molar mass of Mg2Cl is 84.063 g/mol
Calculate molecular weight
Molecular weights calculated on 12/16/20 | Molecular weights calculated on 12/18/20 |
Molecular masses on 11/17/20
Molecular masses on 12/17/19
Please let us know how we can improve this web app.