Molecular weights calculated on 12/15/20 | Molecular weights calculated on 12/17/20 |
Molar mass of CH3(CH2)nC(O)N(CH2CH2OH)2 is 175.2056 g/mol
Molar mass of NH4C2H3O2 is 77.08248 g/mol
Molar mass of C8H18 is 114.22852 g/mol
Molar mass of p is 30.973762 g/mol
Molar mass of Al2O3 is 101.9612772 g/mol
Molar mass of ethanol is 46.06844 g/mol
Molar mass of ethanol is 46.06844 g/mol
Molar mass of CH3CH2OCH3 is 60.09502 g/mol
Molar mass of h is 1.00794 g/mol
Molar mass of LiNO3 is 68.9459 g/mol
Molar mass of Mg3(PO4)2 is 262.857724 g/mol
Molar mass of Cl is 35.453 g/mol
Molar mass of AlPO4 is 121.9529006 g/mol
Molar mass of cl2 is 70.906 g/mol
Molar mass of O3 is 47.9982 g/mol
Molar mass of Al2 is (SO4)3 g/mol
Molar mass of FeSO4 is 151.9076 g/mol
Molar mass of CH3CH2CH2OH is 60.09502 g/mol
Molar mass of H2SO4 is 98.07848 g/mol
Molar mass of Al(OH)3 is 78.0035586 g/mol
Molar mass of CH3CH2CHO is 58.07914 g/mol
Molar mass of C6h12o6 is 180.15588 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of PbSO4 is 303.2626 g/mol
Molar mass of C5 is 60.0535 g/mol
Molar mass of C5 is 60.0535 g/mol
Molar mass of N2 is 28.0134 g/mol
Molar mass of K2SO4 is 174.2592 g/mol
Molar mass of F3 is 56.9952096 g/mol
Molar mass of CH3CH2COOH is 74.07854 g/mol
Molar mass of FeSO4 is 151.9076 g/mol
Molar mass of c2h2 is 26.03728 g/mol
Molar mass of Al2Cl6 is 266.6810772 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of H10 is 10.0794 g/mol
Molar mass of O2 is 31.9988 g/mol
Molar mass of O2 is 31.9988 g/mol
Molar mass of O5 is 79.997 g/mol
Molar mass of Al2Cl6 is * g/mol
Molar mass of (NH2)2CO is 60.05526 g/mol
Molar mass of C2h2 is 26.03728 g/mol
Molar mass of Al2Cl6 is * g/mol
Molar mass of Cu9(SO4)2 is 764.0392 g/mol
Molar mass of Al2Cl6 is * g/mol
Molar mass of nh3 is 17.03052 g/mol
Molar mass of Li2S is 45.947 g/mol
Molar mass of Al2(SO4)3 is 342.1508772 g/mol
Molar mass of N2 is 28.0134 g/mol
Molar mass of Br is 79.904 g/mol
Calculate molecular weight
Molecular weights calculated on 12/15/20 | Molecular weights calculated on 12/17/20 |
Molecular masses on 11/16/20
Molecular masses on 12/16/19
Please let us know how we can improve this web app.