| Molecular weights calculated on 11/19/20 | Molecular weights calculated on 11/21/20 |
Molar mass of CuSO4 is 159.6086 g/mol
Molar mass of PCl3 is 137.332762 g/mol
Molar mass of O is 15.9994 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of CH4 is 16.04246 g/mol
Molar mass of ca is 40.078 g/mol
Molar mass of H is 1.00794 g/mol
Molar mass of hcl is 36.46094 g/mol
Molar mass of C12 is H24 g/mol
Molar mass of O is 15.9994 g/mol
Molar mass of O2f2 is 69.9956064 g/mol
Molar mass of h2 is 2.01588 g/mol
Molar mass of KMnO4 is 158.033945 g/mol
Molar mass of ozone is 47.9982 g/mol
Molar mass of C is 12.0107 g/mol
Molar mass of ozone is 47.9982 g/mol
Molar mass of NO2 is 46.0055 g/mol
Molar mass of O is 15.9994 g/mol
Molar mass of N is 14.0067 g/mol
Molar mass of ar is 39.948 g/mol
Molar mass of KBr is 119.0023 g/mol
Molar mass of HF is 20.0063432 g/mol
Molar mass of Ca is 40.078 g/mol
Molar mass of h20 is 20.1588 g/mol
Molar mass of Al2(SO4)3 is 342.1508772 g/mol
Molar mass of NaH₂PO₄ is 119.97701128 g/mol
Molar mass of CH3CH2CO2Na is 96.06036928 g/mol
Molar mass of Al2(CO3)3 is 233.9897772 g/mol
Molar mass of CH3OCH3 is 46.06844 g/mol
Molar mass of Na2SO3 is 126.04273856 g/mol
Molar mass of HClO₄ is 100.45854 g/mol
Molar mass of Al is 26.9815386 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of H2SO4 is 98.07848 g/mol
Molar mass of KOH is 56.10564 g/mol
Molar mass of Calcium is carbonate g/mol
Molar mass of HKNO3 is 102.11114 g/mol
Molar mass of CH3(CH2)7CHCH(CH2)7CO2C7H9 is 374.59978 g/mol
Molar mass of *2HCl is 72.92188 g/mol
Molar mass of H3PO3 is 81.995782 g/mol
Molar mass of Fe3O4 is 231.5326 g/mol
Molar mass of Li is 6.941 g/mol
Molar mass of Fe is 55.845 g/mol
Molar mass of CH3CH2OH is 46.06844 g/mol
Molar mass of NH4OH is 35.0458 g/mol
Molar mass of H2SO4 is 98.07848 g/mol
Molar mass of GeF4 is 148.6336128 g/mol
Molar mass of *2HCI is 279.84622 g/mol
Molar mass of H2o is 18.01528 g/mol
Calculate molecular weight
| Molecular weights calculated on 11/19/20 | Molecular weights calculated on 11/21/20 |
Molecular masses on 10/21/20
Molecular masses on 11/20/19
Please let us know how we can improve this web app.
