Molecular weights calculated on 11/17/20 | Molecular weights calculated on 11/19/20 |
Molar mass of *Al2 is 53.9630772 g/mol
Molar mass of Fe(NH4)2 is (SO4)2 g/mol
Molar mass of C2H5OH is 46.06844 g/mol
Molar mass of *2Al is 53.9630772 g/mol
Molar mass of Na2CO3*10 is H2O g/mol
Molar mass of KNO3 is 101.1032 g/mol
Molar mass of Mn is 54.938045 g/mol
Molar mass of Ba(NO3)2 is 261.3368 g/mol
Molar mass of Mg(OH)2 is 58.31968 g/mol
Molar mass of H2SO4 is 98.07848 g/mol
Molar mass of Fe(OH)3 is 106.86702 g/mol
Molar mass of C2h3br2 is 186.85322 g/mol
Molar mass of CH3NO2 is 61.04002 g/mol
Molar mass of Cl2O7 is 182.9018 g/mol
Molar mass of Fe3(PO3)2 is 325.478924 g/mol
Molar mass of H1O16Ca40 is 1860.11834 g/mol
Molar mass of K[Al(OH)4] is 134.1091986 g/mol
Molar mass of MgSO3 is 104.3682 g/mol
Molar mass of CH2 is 14.02658 g/mol
Molar mass of MgSO3 is 104.3682 g/mol
Molar mass of CH2ICH(CH3)CH(CH3)CHICH2CH2CH3 is 380.04816 g/mol
Molar mass of br2o7 is 271.8038 g/mol
Molar mass of Na2CO3 is H2O g/mol
Molar mass of CaSO4 is 136.1406 g/mol
Molar mass of C2H5 is 29.0611 g/mol
Molar mass of Na2CO3*10 is H2O g/mol
Molar mass of NaCI is 161.90493928 g/mol
Molar mass of O2 is 31.9988 g/mol
Molar mass of NaCI is 161.90493928 g/mol
Molar mass of Nh3 is 17.03052 g/mol
Molar mass of Ne is 20.1797 g/mol
Molar mass of h20 is 20.1588 g/mol
Molar mass of HgO is 216.5894 g/mol
Molar mass of Al2(SO4)3 is 342.1508772 g/mol
Molar mass of h20 is 20.1588 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of P5 is 154.86881 g/mol
Molar mass of Na2CO3*10H2O is 286.14123856 g/mol
Molar mass of xe is 131.293 g/mol
Molar mass of Al2(SO4)3 is 342.1508772 g/mol
Molar mass of CH3co2h is 133.90885 g/mol
Molar mass of Ba3(PO4)2 is 601.923724 g/mol
Molar mass of Fe is N g/mol
Molar mass of C2H3OC is 55.05532 g/mol
Molar mass of Ba is 137.327 g/mol
Molar mass of *2H2SO is 100.16056 g/mol
Molar mass of Ca(OH)2 is 74.09268 g/mol
Molar mass of Al2(SO4)3 is 342.1508772 g/mol
Molar mass of AgBrO3 is 235.7704 g/mol
Calculate molecular weight
Molecular weights calculated on 11/17/20 | Molecular weights calculated on 11/19/20 |
Molecular masses on 10/19/20
Molecular masses on 11/18/19
Please let us know how we can improve this web app.