| Molecular weights calculated on 08/13/20 | Molecular weights calculated on 08/15/20 |
| 1 |
Molar mass of K2SO4 is 174.2592 g/mol
Molar mass of Ru is 101.07 g/mol
Molar mass of Ph is H g/mol
Molar mass of PhH is 78.11184 g/mol
Molar mass of C(C(C(C(CH3)3)3)3)3 is 1698.22412 g/mol
Molar mass of C(C(C(C(C(C(C(C(C(C(C(C(C(C(CH3)3)3)3)3)3)3)3)3)3)3)3)3)3)3 is 100633039.96868 g/mol
Molar mass of HOH is 18.01528 g/mol
Molar mass of C(oh)4 is 48.0428 g/mol
Molar mass of CaCO3 is 100,0869 g/mol
Molar mass of CH3COOCl is 94.49702 g/mol
Molar mass of CuSO45H2O is 833.59928 g/mol
Molar mass of NaHSO4 is 120.06030928 g/mol
Molar mass of K4Fe(CN)6 is 368.3426 g/mol
Molar mass of K4Fe(CN)6 is 368.3426 g/mol
Molar mass of K4Fe(CN)6 is 368.3426 g/mol
Molar mass of K4Fe(CN)6 is 368.3426 g/mol
Molar mass of K4Fe(CN)6 is 368.3426 g/mol
Molar mass of K4Fe(CN)6 is 368.3426 g/mol
Molar mass of MgO is 40,3044 g/mol
Molar mass of NH4SiO4 is 110,12156 g/mol
Molar mass of HCl is 36,46094 g/mol
Molar mass of C2H2(COOH)2 is name g/mol
Molar mass of C2H2(COOH)2 is name g/mol
Molar mass of CuSO4 is 159,6086 g/mol
| 1 |
| Molecular weights calculated on 08/13/20 | Molecular weights calculated on 08/15/20 |
Molecular masses on 07/15/20
Molecular masses on 08/14/19
Please let us know how we can improve this web app.
