| Molecular weights calculated on 07/22/20 | Molecular weights calculated on 07/24/20 |
| 1 |
Molar mass of PdCl5 is 283.685 g/mol
Molar mass of Zn(NO3)2*6H2O is 297.48148 g/mol
Molar mass of Zn(NO3)2*6H2O is 297.48148 g/mol
Molar mass of CO2 is 44,0095 g/mol
Molar mass of C24H20N6O8Pd2(CH3CN)1(H2O)7 is 900,44988 g/mol
Molar mass of MgCl2 is 95,211 g/mol
Molar mass of MgCl2 is 95,211 g/mol
Molar mass of MgCl2 is 95,211 g/mol
Molar mass of Co2O5 is 197,86339 g/mol
Molar mass of C24 is H42 g/mol
Molar mass of CH3NH2 is 31,0571 g/mol
Molar mass of Na2CO3*12H2O is 322.17179856 g/mol
Molar mass of CCl4 is 153,8227 g/mol
Molar mass of c3h10o1 is 62,1109 g/mol
Molar mass of C4H6 is 54,09044 g/mol
Molar mass of NH3 is 17,03052 g/mol
Molar mass of Ar is 39,948 g/mol
Molar mass of Ar is 39,948 g/mol
Molar mass of Sf6 is 146,0554192 g/mol
Molar mass of SF6 is 146,0554192 g/mol
Molar mass of Ar is 39,948 g/mol
Molar mass of Ar is 39,948 g/mol
Molar mass of Kr2Cr2O7 is 383.584 g/mol
Molar mass of P04 is 123,895048 g/mol
Molar mass of P04 is 123,895048 g/mol
Molar mass of H2O2 is 34.01468 g/mol
Molar mass of CO3 is 60,0089 g/mol
Molar mass of CO3 is 60,0089 g/mol
Molar mass of CO3 is 60,0089 g/mol
Molar mass of Br2 is 159.808 g/mol
Molar mass of N4H2 is 58.04268 g/mol
Molar mass of C6H5N3O9 is 263,1186 g/mol
| 1 |
| Molecular weights calculated on 07/22/20 | Molecular weights calculated on 07/24/20 |
Molecular masses on 06/23/20
Molecular masses on 07/23/19
Please let us know how we can improve this web app.
