| Molecular weights calculated on 03/07/20 | Molecular weights calculated on 03/09/20 |
| 1 |
Molar mass of Na2SO4 is 142,04213856 g/mol
Molar mass of Cr is 51.9961 g/mol
Molar mass of K2O4 is 142,1942 g/mol
Molar mass of K2O4 is 142,1942 g/mol
Molar mass of Na2CO3 is 105,98843856 g/mol
Molar mass of KMnO4 is 158,033945 g/mol
Molar mass of MnSi is 83.023545 g/mol
Molar mass of C9h10o2 is 150,1745 g/mol
Molar mass of HClIO2 is 195.36421 g/mol
Molar mass of Al2O3 is 101,9612772 g/mol
Molar mass of O2 is 31,9988 g/mol
Molar mass of Fe(OH)3 is 106,86702 g/mol
Molar mass of Fe2O3 is 159,6882 g/mol
Molar mass of CuO is 79,5454 g/mol
Molar mass of Cu is 63,546 g/mol
Molar mass of mg(oh)2 is 58.31968 g/mol
Molar mass of C5H9P is 100,098722 g/mol
Molar mass of C5H15Si2PO is 178,316762 g/mol
Molar mass of (NH4)3PO4 is 149.086742 g/mol
Molar mass of NO2 is 46.0055 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of Ba3P is 442.954762 g/mol
Molar mass of CH3CH2CH2CH(CH3)2CHOHCH2COOH is 175.24536 g/mol
Molar mass of K is 39,0983 g/mol
Molar mass of C10H16N5O13P3 is 507,181026 g/mol
Molar mass of al(oh)3 is 78,0035586 g/mol
Molar mass of Al2(SO4)3 is 342.1508772 g/mol
| 1 |
| Molecular weights calculated on 03/07/20 | Molecular weights calculated on 03/09/20 |
Molecular masses on 02/07/20
Molecular masses on 03/08/19
Please let us know how we can improve this web app.
