Molecular weights calculated on 10/17/17 | Molecular weights calculated on 10/19/17 |
Molar mass of CuSO4*5H2O is 249.685 g/mol
Molar mass of Na2S2O3 is 158.10773856 g/mol
Molar mass of Ni(C4H7O2N2)2 is 288.91456 g/mol
Molar mass of CH3(CH2)11(OCH2CH2)1OSO3Na is 332.43182928 g/mol
Molar mass of Ni is 58,6934 g/mol
Molar mass of H2SO4 is 98,07848 g/mol
Molar mass of K3Fe(C2O4)3 is 437.1969 g/mol
Molar mass of H2C8H4O4 is 166.13084 g/mol
Molar mass of LiO2 is 38.9398 g/mol
Molar mass of Cu is 63,546 g/mol
Molar mass of Na2o is 61.97893856 g/mol
Molar mass of Na2o is 61.97893856 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of Ca(OH)2 is 74.09268 g/mol
Molar mass of (NH4)2CO3 is 96.08582 g/mol
Molar mass of (NH4)2CO3 is 96.08582 g/mol
Molar mass of K3N is 131.3016 g/mol
Molar mass of CuSO4 is 159,6086 g/mol
Molar mass of H2C4H4O4 is 118.08804 g/mol
Molar mass of H3CHNH2OH is 49,07238 g/mol
Molar mass of FeSO4 is 151.9076 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of MgF2 is 62.3018064 g/mol
Molar mass of C2H6O is 46.06844 g/mol
Molar mass of Fe2(SO4)3 is 399.8778 g/mol
Molar mass of CaCl2 is 110.984 g/mol
Molar mass of (NH4)3PO3 is 133.087342 g/mol
Molar mass of H3PO4 is 97.995182 g/mol
Molar mass of He is 4.002602 g/mol
Molar mass of Al2O3 is 101.9612772 g/mol
Molar mass of Fe2(SO4)3 is 399.8778 g/mol
Molar mass of ZnC2O4 is 153.399 g/mol
Molar mass of C2H5N3O3 is 119.0794 g/mol
Molar mass of F2 is 37.9968064 g/mol
Molar mass of Na2SO4 is 142.04213856 g/mol
Molar mass of H2 is 2.01588 g/mol
Molar mass of H2C4H2O4 is 116.07216 g/mol
Molar mass of Al2O3 is 101.9612772 g/mol
Molar mass of beryllium is 9.012182 g/mol
Molar mass of H2C4H4O5 is 134.08744 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of water is 18.01528 g/mol
Molar mass of Be(OH)2 is 43.026862 g/mol
Molar mass of C6H14O6 is 182.17176 g/mol
Molar mass of water is 18.01528 g/mol
Molar mass of CoCl2 is 129.839195 g/mol
Molar mass of Na2SO4 is 142,04213856 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Calculate molecular weight
Molecular weights calculated on 10/17/17 | Molecular weights calculated on 10/19/17 |
Molecular masses on 09/18/17
Molecular masses on 10/18/16
Please let us know how we can improve this web app.