Molecular weights calculated on 04/05/16 | Molecular weights calculated on 04/07/16 |
Molar mass of NaNO2 is 68,99526928 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of COCl2*6H2O is 207.00778 g/mol
Molar mass of NaH2Po4 is 860.93537088 g/mol
Molar mass of kr2cr207 is 10930.7887 g/mol
Molar mass of kr2cr207 is 10930.7887 g/mol
Molar mass of CO2H is 45.01744 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of Br2 is 159.808 g/mol
Molar mass of NaNO2 is 68,99526928 g/mol
Molar mass of kr2cr207 is in g/mol
Molar mass of kr2cr207 is in g/mol
Molar mass of CO is 28.0101 g/mol
Molar mass of C6H9 is 81.13566 g/mol
Molar mass of CO is 28.0101 g/mol
Molar mass of CO is 28.0101 g/mol
Molar mass of PPh3 is 262,285462 g/mol
Molar mass of MnO4 is 118.935645 g/mol
Molar mass of NH43PO4 is 152,319482 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of Ba(OH)2 is 171.34168 g/mol
Molar mass of PPh3 is 262,285462 g/mol
Molar mass of C15H31COONa is 278.40590928 g/mol
Molar mass of (NH4)3PO4 is 149,086742 g/mol
Molar mass of MnO4Fe is 174.780645 g/mol
Molar mass of Ni(NO)Br(PPh3)2 is 693,174424 g/mol
Molar mass of KPO4 is 134,069662 g/mol
Molar mass of NaCO3*10H2O is 263.15146928 g/mol
Molar mass of CoCl2 is 129.839195 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of Fe(SO4) is 151.9076 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of C6H12O6(glucose) is 180.15588 g/mol
Molar mass of CoCl2*6H2O is 237.930875 g/mol
Molar mass of CO(NH3)5(CO3)NO3 is 235.1765 g/mol
Molar mass of SiO2 is 60,0843 g/mol
Molar mass of H3PO4 is 97.995182 g/mol
Molar mass of Co(NH3)5(CO3)NO3 is 266.099595 g/mol
Molar mass of OH is 17.00734 g/mol
Molar mass of OH is 17.00734 g/mol
Molar mass of NaH2PO4 is 119.97701128 g/mol
Molar mass of Ni((CH3)3CCOCH2COC(CH3)3)2(H2O)2 is 463.27456 g/mol
Molar mass of (CH3COO)2Cu*H2O is 199.64932 g/mol
Molar mass of BaCl2 is 208.233 g/mol
Molar mass of BaCl2 is 208.233 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of Ni((CH3)3CCOCH2COC(CH3)3)2 is 427.244 g/mol
Molar mass of F is 18.9984032 g/mol
Calculate molecular weight
Molecular weights calculated on 04/05/16 | Molecular weights calculated on 04/07/16 |
Molecular masses on 03/07/16
Molecular masses on 04/06/15
Please let us know how we can improve this web app.