Molecular weights calculated on 03/01/16 | Molecular weights calculated on 03/03/16 |
Molar mass of MgNH4PO4*6H2O is 245.406502 g/mol
Molar mass of H3PO4 is 97,995182 g/mol
Molar mass of K2Cr2O7 is 294,1846 g/mol
Molar mass of K3PO4 is 212.266262 g/mol
Molar mass of NH3 is 17,03052 g/mol
Molar mass of SiH4 is 32.11726 g/mol
Molar mass of SiH4 is 32.11726 g/mol
Molar mass of N2O2ArCO2NeHeCH is 181,170642 g/mol
Molar mass of HCO3 is 61,01684 g/mol
Molar mass of al is 26,9815386 g/mol
Molar mass of NaReO4 is 273.19436928 g/mol
Molar mass of C5H10 is 70.1329 g/mol
Molar mass of C3H8 is + g/mol
Molar mass of H3PO4 is 97,995182 g/mol
Molar mass of Li2CrO4 is 129.8757 g/mol
Molar mass of HNO3 is 63,01284 g/mol
Molar mass of NH2CHCOOH is 74.05866 g/mol
Molar mass of Co(NO3)3 is 244.947895 g/mol
Molar mass of MgSO4 is 120.3676 g/mol
Molar mass of NaOH is 39,99710928 g/mol
Molar mass of H2SO4 is 98.07848 g/mol
Molar mass of Ag2CO3 is 275.7453 g/mol
Molar mass of Ca(OH)2 is 74,09268 g/mol
Molar mass of c2h6o2 is 62.06784 g/mol
Molar mass of NH4CI is 156,95363 g/mol
Molar mass of NaHCO3 is 84,00660928 g/mol
Molar mass of AgCl is 143.3212 g/mol
Molar mass of Fe2o3 is 159.6882 g/mol
Molar mass of NH4CI is nome g/mol
Molar mass of CaSO4 is 136.1406 g/mol
Molar mass of CaSO4 is 136.1406 g/mol
Molar mass of P2O5 is 141.944524 g/mol
Molar mass of ZnSO4 is ∙7H2O g/mol
Molar mass of Cr2O3 is 151,9904 g/mol
Molar mass of CoCl2 is 129.839195 g/mol
Molar mass of Al is 26.9815386 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of AuCl is 232.419569 g/mol
Molar mass of ZrCl4 is 233.036 g/mol
Molar mass of Mg(OH)2 is 58,31968 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of NaCI is 161,90493928 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of SnF2 is 156.7068064 g/mol
Molar mass of ZnSO4 is 161,4426 g/mol
Molar mass of C4N3OH4C4OH5CH3(SiCH3CH3C(CH3)3)2 is 424.74808 g/mol
Molar mass of NaOH is 39,99710928 g/mol
Molar mass of Na2B4O7*10H2O is 381.37213856 g/mol
Calculate molecular weight
Molecular weights calculated on 03/01/16 | Molecular weights calculated on 03/03/16 |
Molecular masses on 02/01/16
Molecular masses on 03/02/15
Please let us know how we can improve this web app.