Molecular weights calculated on 02/28/16 | Molecular weights calculated on 03/01/16 |
Molar mass of CaO is 56.0774 g/mol
Molar mass of As2O3 is 197,8414 g/mol
Molar mass of Na2S2O3 is 158,10773856 g/mol
Molar mass of PO4 is 94,971362 g/mol
Molar mass of Na is 22,98976928 g/mol
Molar mass of Na2HPO4 is 141.95884056 g/mol
Molar mass of S is 32,065 g/mol
Molar mass of NaI is 149.89423928 g/mol
Molar mass of bromine is 159.808 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of K2Mn2Mo2Sb2O15 is 863.50369 g/mol
Molar mass of C6H6CH2CH(NHCH3)CH3(H2PO4) is C g/mol
Molar mass of C9H8O4 is 180.15742 g/mol
Molar mass of NaCl is 58,44276928 g/mol
Molar mass of CI2O3 is 313,81784 g/mol
Molar mass of Mg(OH)2 is 58.31968 g/mol
Molar mass of PO4H2 is 96,987242 g/mol
Molar mass of PO4H2 is 96,987242 g/mol
Molar mass of Cl2 is 70.906 g/mol
Molar mass of K1(OH)1 is 56,10564 g/mol
Molar mass of C25 is H21 g/mol
Molar mass of S8 is 24F2 g/mol
Molar mass of CaCO3 is 100.0869 g/mol
Molar mass of CaCO3 is 100.0869 g/mol
Molar mass of CH2ClCOOCH3 is 108,5236 g/mol
Molar mass of Na3PO412H2O is 6709.71114984 g/mol
Molar mass of Na3PO4*12H2O is 380.12402984 g/mol
Molar mass of Fe(ClO4)2*6H2O is 362.83788 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of NaOH is 39,99710928 g/mol
Molar mass of AgCl is 143,3212 g/mol
Molar mass of Na2CO3 is 105,98843856 g/mol
Molar mass of H2SO4 is 98.07848 g/mol
Molar mass of Pb4(OH)1 is 845,80734 g/mol
Molar mass of KAl(SO4)2 is 258.2050386 g/mol
Molar mass of Ag is 107.8682 g/mol
Molar mass of o is 15.9994 g/mol
Molar mass of Fe2O3 is 159.6882 g/mol
Molar mass of KAl(SO4)2*5H2O is 348.2814386 g/mol
Molar mass of CuSO4*5H2O is 249.685 g/mol
Molar mass of SiO2 is 60.0843 g/mol
Molar mass of NaN3(s) is nome g/mol
Molar mass of H2OSO4 is 114,07788 g/mol
Molar mass of ZnO is 81.3794 g/mol
Molar mass of KAl(SO4)2*12H2O is 474.3883986 g/mol
Molar mass of [Co(en)3]Cl3 is 283.158585 g/mol
Molar mass of BaCO3 is 197.3359 g/mol
Molar mass of NaNO3 is 84,99466928 g/mol
Molar mass of Mg(CH3COO)2(H2O)4 is 214.45416 g/mol
Calculate molecular weight
Molecular weights calculated on 02/28/16 | Molecular weights calculated on 03/01/16 |
Molecular masses on 01/30/16
Molecular masses on 03/01/15
Please let us know how we can improve this web app.