Molecular weights calculated on 02/22/16 | Molecular weights calculated on 02/24/16 |
Molar mass of [Co(ONO)(NH3)5]Cl2 is 260,997295 g/mol
Molar mass of CaC2O4H2O4 is 194,11048 g/mol
Molar mass of Zn is 65.38 g/mol
Molar mass of Al(OH)3 is 78,0035586 g/mol
Molar mass of Zn is 65.38 g/mol
Molar mass of K2C2O4*H2O is 184.23088 g/mol
Molar mass of (Fe(NO3)3)9H2O is 2194.75258 g/mol
Molar mass of NH4OH is 35,0458 g/mol
Molar mass of Pb2cl is 449.853 g/mol
Molar mass of CaC2O4 is 128,097 g/mol
Molar mass of BrF5 is 174.896016 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of [Ni(en)3]Cl is 211.5332 g/mol
Molar mass of C6H12O6 is 180.15588 g/mol
Molar mass of Na2CO3*10H2O is 286.14123856 g/mol
Molar mass of Fe is O3 g/mol
Molar mass of Bi2(SO3)3 is 658,1504 g/mol
Molar mass of Zn(NO3)2 is 189.3898 g/mol
Molar mass of *2Al is 53.9630772 g/mol
Molar mass of CaC2O4H2O is 146,11228 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of Xe is F4 g/mol
Molar mass of CuSO4 is 159.6086 g/mol
Molar mass of Na is 22.98976928 g/mol
Molar mass of Pt(SO4)2 is 387.2092 g/mol
Molar mass of Ni(C5H4)(Si(CH3)2)2B(C6F5)4 is 918.123604 g/mol
Molar mass of C is 12.0107 g/mol
Molar mass of BeCl2 is 79.918182 g/mol
Molar mass of Ni(C5H4)2(Si(CH3)2)2B(C6F5)4 is 982.208864 g/mol
Molar mass of Mg(oh)2 is 48.61 g/mol
Molar mass of H2O is 18,01528 g/mol
Molar mass of Mg(oh)2 is 48.61 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of Ar is 39.948 g/mol
Molar mass of [Ni(NH2CH2CH2NH2)3]Cl2 is 309.89436 g/mol
Molar mass of CH4 is 16.04246 g/mol
Molar mass of Na2CO3*1OH2O is 140.00311856 g/mol
Molar mass of C9H11N is 133.19034 g/mol
Molar mass of Br2 is 159.808 g/mol
Molar mass of K2Cr2O7 is 294,1846 g/mol
Molar mass of C9H11NO is 149.18974 g/mol
Molar mass of BF3 is 67.8062096 g/mol
Molar mass of N is 14,0067 g/mol
Molar mass of C9H12NO is 150.19768 g/mol
Molar mass of Ba(OH)2 is 171.34168 g/mol
Molar mass of NaH2PO4*h20 is 140.13581128 g/mol
Molar mass of Sn(CO3) is 178.7189 g/mol
Molar mass of AgCo3 is 284.667785 g/mol
Molar mass of CO2 is 44.0095 g/mol
Calculate molecular weight
Molecular weights calculated on 02/22/16 | Molecular weights calculated on 02/24/16 |
Molecular masses on 01/24/16
Molecular masses on 02/23/15
Please let us know how we can improve this web app.