Molecular weights calculated on 02/07/16 | Molecular weights calculated on 02/09/16 |
Molar mass of MgCO3 is 84.3139 g/mol
Molar mass of C12H22O11 is 342.29648 g/mol
Molar mass of H is 1.00794 g/mol
Molar mass of H is 1.00794 g/mol
Molar mass of PtCl(C2H10B10S) is 404,8128 g/mol
Molar mass of PtCl(C2H10B10S)(CH3COCH3) is 462,89194 g/mol
Molar mass of HF is 20.0063432 g/mol
Molar mass of HF is 20.0063432 g/mol
Molar mass of C4H9OH is 74,1216 g/mol
Molar mass of HF is 20.0063432 g/mol
Molar mass of FeS2 is 119.975 g/mol
Molar mass of h20 is 20.1588 g/mol
Molar mass of CSH2 is 46,09158 g/mol
Molar mass of SO2 is 64.0638 g/mol
Molar mass of CuSO4*5H2O is 249.685 g/mol
Molar mass of Ca(H2PO4)2 is 234.052484 g/mol
Molar mass of SO4*5H2O is 186.139 g/mol
Molar mass of feCl3 is 162.204 g/mol
Molar mass of SrS2O7 is 263.7458 g/mol
Molar mass of c12 is 144,1284 g/mol
Molar mass of CO is 28.0101 g/mol
Molar mass of H3PO4 is 97.995182 g/mol
Molar mass of (Na2S2O3) is 158,10773856 g/mol
Molar mass of ThCo2Si2 is 406.07545 g/mol
Molar mass of Fe2O3 is 159.6882 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of Mn(OH)2 is 88,952725 g/mol
Molar mass of LiBO2 is 49.7508 g/mol
Molar mass of LiBO2 is 49.7508 g/mol
Molar mass of KClO3 is 122.5495 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of C12H22MgO14 is 414.59968 g/mol
Molar mass of c6h6 is 78.11184 g/mol
Molar mass of FeCl3 is 162.204 g/mol
Molar mass of AgNOO3 is 185.8725 g/mol
Molar mass of C17H26O4 is + g/mol
Molar mass of BaCO3 is 197.3359 g/mol
Molar mass of C3H8O is 60.09502 g/mol
Molar mass of N2 is 28.0134 g/mol
Molar mass of K3[Fe(ox)3]3H2O is 637.91518 g/mol
Molar mass of [Co(NH3)6]Cl3 is 267.475315 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of Pb(NO3)2 is 331.2098 g/mol
Molar mass of [Co(NH3)3 is (NO2)3] g/mol
Molar mass of [Co(NH3)3(NO2)3] is 248.041255 g/mol
Molar mass of PbI2 is 461.00894 g/mol
Molar mass of C18H19NO4 is 313.34776 g/mol
Molar mass of Mg6(Si4O10)(OH)8 is 554.22472 g/mol
Molar mass of O4H10 is 74.077 g/mol
Calculate molecular weight
Molecular weights calculated on 02/07/16 | Molecular weights calculated on 02/09/16 |
Molecular masses on 01/09/16
Molecular masses on 02/08/15
Please let us know how we can improve this web app.