Molecular weights calculated on 02/03/16 | Molecular weights calculated on 02/05/16 |
Molar mass of CoCO3 is 118.942095 g/mol
Molar mass of HCH2CHCO2 is 72.06266 g/mol
Molar mass of FeCl2 is 126.751 g/mol
Molar mass of FeCl2 is 126.751 g/mol
Molar mass of N2H2 is 30,02928 g/mol
Molar mass of Ca(oh)2 is 80,156 g/mol
Molar mass of NH4SO2 is 82.10226 g/mol
Molar mass of (NH4)2CO3 is 96.08582 g/mol
Molar mass of KClO3 is 122,5495 g/mol
Molar mass of Na3PO4 is 163.94066984 g/mol
Molar mass of CH3CH2COOH is what g/mol
Molar mass of Fe is 55.845 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of C12H22O11 is 342.29648 g/mol
Molar mass of MgSO4 is 120,3676 g/mol
Molar mass of Ca3(PO4)2 is 310.176724 g/mol
Molar mass of li is 6,941 g/mol
Molar mass of Mg is 24.305 g/mol
Molar mass of AgNO3 is 169,8731 g/mol
Molar mass of C3NO2H6 is 88.08524 g/mol
Molar mass of Ni(NH3)4SO4 is 222.87808 g/mol
Molar mass of Mg(NO3)2 is 148,3148 g/mol
Molar mass of Ar is 39.948 g/mol
Molar mass of H2SO4 is 98.07848 g/mol
Molar mass of CuSO4(H2O)5 is 249.685 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of P2O2 is H2O g/mol
Molar mass of SO2 is 64.0638 g/mol
Molar mass of CO is 28.0101 g/mol
Molar mass of (NH4)2SO4 is 132.13952 g/mol
Molar mass of CoCl2(H2O)6 is 237.930875 g/mol
Molar mass of FeCl2 is 126.751 g/mol
Molar mass of C2H5OH is 46.06844 g/mol
Molar mass of H2SO3 is 82.07908 g/mol
Molar mass of Br is 79.904 g/mol
Molar mass of (NH4)2SO4 is 132.13952 g/mol
Molar mass of Na is 22.98976928 g/mol
Molar mass of HCH3CO2 is 60.05196 g/mol
Molar mass of Ca is 40.078 g/mol
Molar mass of NaBr is 102.89376928 g/mol
Molar mass of Al2O3 is 101.9612772 g/mol
Molar mass of Na2SO4 is 142.04213856 g/mol
Molar mass of P4W18O12O28(O2)6(H2O)2(O2)8(H2O)4O is 4645.065328 g/mol
Molar mass of KI is 166.00277 g/mol
Molar mass of Al(ClO3)3 is 277.3351386 g/mol
Molar mass of Na2SO4 is 142.04213856 g/mol
Molar mass of P4W18O12O28(O2)6(H2O)2(O2)8(H2O)4OK10Li6 is 5077.694328 g/mol
Molar mass of H2C6H6O6 is 176.12412 g/mol
Molar mass of Cr2(CO3)3 is 284.0189 g/mol
Calculate molecular weight
Molecular weights calculated on 02/03/16 | Molecular weights calculated on 02/05/16 |
Molecular masses on 01/05/16
Molecular masses on 02/04/15
Please let us know how we can improve this web app.