Molecular weights calculated on 01/25/16 | Molecular weights calculated on 01/27/16 |
Molar mass of C3H8O3 is 92.09382 g/mol
Molar mass of H3PO4 is 97.995182 g/mol
Molar mass of Cl2 is 70.906 g/mol
Molar mass of Cl2 is 70.906 g/mol
Molar mass of C16N16S4Ni(C5H5N)2(H2O)2 is 797,46216 g/mol
Molar mass of C16N16S4Ni(C5H5N)2(H2O)3 is 815,47744 g/mol
Molar mass of C16N16S4Ni(C5H5N)2(H2O)2 is 797,46216 g/mol
Molar mass of h is 1.00794 g/mol
Molar mass of n is 14.0067 g/mol
Molar mass of C16N16S4Ni(C5H5N)2(H2O)3 is 815,47744 g/mol
Molar mass of Ni(dmgH)2 is 290.93044 g/mol
Molar mass of c is 12.0107 g/mol
Molar mass of P4 is 123.895048 g/mol
Molar mass of MgCl2*6H2O is 203,30268 g/mol
Molar mass of PH3 is 33.997582 g/mol
Molar mass of KOH is 56.10564 g/mol
Molar mass of KNO3 is 101.1032 g/mol
Molar mass of AgNO3 is 169.8731 g/mol
Molar mass of C9H12N2O6 is 244.20138 g/mol
Molar mass of Cu2O is 143.0914 g/mol
Molar mass of C16H8N6Pt(C2H10B10S)2(CH3COCH3) is 885,98966 g/mol
Molar mass of C16H8N6Pt(C2H10B10S)2(CH3COCH3)4 is 1060,22708 g/mol
Molar mass of BeCl2 is 79.918182 g/mol
Molar mass of FeCl3 is 162.204 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of Pt(C2H10B10S)2(CH3COCH3) is 601,71474 g/mol
Molar mass of [Ni(NH3)6]Cl2 is 231.78252 g/mol
Molar mass of CH2 is 14.02658 g/mol
Molar mass of BF3 is 67.8062096 g/mol
Molar mass of co3 is 176.799585 g/mol
Molar mass of [(NH3)5Co(O2)Co(NH3)5] is 320.17039 g/mol
Molar mass of CCl2F2 is 120.9135064 g/mol
Molar mass of C2H5OH is 46.06844 g/mol
Molar mass of c is o g/mol
Molar mass of c is o2 g/mol
Molar mass of co2 is 117.86639 g/mol
Molar mass of Mg(OH)2 is 58.31968 g/mol
Molar mass of [(NH3)5Co(O2)Co(NH3)5]4 is 1280.68156 g/mol
Molar mass of C6H5C(C6H4OCH3)2Cl is 338.82736 g/mol
Molar mass of CH2O is H2O g/mol
Molar mass of MgCl is 59.758 g/mol
Molar mass of UF6 is 352.0193292 g/mol
Molar mass of [(NH3)5Co(O2)Co(NH3)5]5 is 1600.85195 g/mol
Molar mass of SiO2 is 60.0843 g/mol
Molar mass of C6H12O6 is 180.15588 g/mol
Molar mass of C6H12O6 is 180.15588 g/mol
Molar mass of C₅H₅N is 79.0999 g/mol
Molar mass of H20 is 20.1588 g/mol
Molar mass of CuO is 79.5454 g/mol
Calculate molecular weight
Molecular weights calculated on 01/25/16 | Molecular weights calculated on 01/27/16 |
Molecular masses on 12/27/15
Molecular masses on 01/26/15
Please let us know how we can improve this web app.