Molecular weights calculated on 01/24/16 | Molecular weights calculated on 01/26/16 |
Molar mass of CH3COOCH3 is 74.07854 g/mol
Molar mass of NaClO3 is 106.44096928 g/mol
Molar mass of K2Cr2O4H2O is 264.20168 g/mol
Molar mass of Al2(SO4)3 is 342.1508772 g/mol
Molar mass of V3(Po4)5 is 4332.473108 g/mol
Molar mass of zr is 91.224 g/mol
Molar mass of C6H4Cl2 is 147.00196 g/mol
Molar mass of K2Cr2O4*H2O is 264.20168 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of Na2SO4 is 142.04213856 g/mol
Molar mass of Mg(NO3)2 is 148.3148 g/mol
Molar mass of C6H5COOH is 122.12134 g/mol
Molar mass of LiMnPO4 is 156.850407 g/mol
Molar mass of Co(C2H3O2)2 is 177.021235 g/mol
Molar mass of Ca3p2 is 182.181524 g/mol
Molar mass of Ni((C2H5)2NCH2CH2NH2)2(NCS)2 is 407.26748 g/mol
Molar mass of CO is 28.0101 g/mol
Molar mass of KClO3 is 122,5495 g/mol
Molar mass of S is 32,065 g/mol
Molar mass of Al2 is (CrO4)3 g/mol
Molar mass of Fe2(SO4)3 is 399.8778 g/mol
Molar mass of Mg is 24.305 g/mol
Molar mass of C4H8O4 is 120.10392 g/mol
Molar mass of H2 is 2.01588 g/mol
Molar mass of Na2o is 61.97893856 g/mol
Molar mass of si is 28.0855 g/mol
Molar mass of Pb(SO4)2 is 399.3252 g/mol
Molar mass of N2F2 is 66.0102064 g/mol
Molar mass of fe is 55.845 g/mol
Molar mass of Ag2S is 247.8014 g/mol
Molar mass of NH4NO is ->N2 g/mol
Molar mass of XeF{- is } g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of XeF{+ is } g/mol
Molar mass of (SO4)2 is 192.1252 g/mol
Molar mass of KI is 166.00277 g/mol
Molar mass of H1C4 is 49.05074 g/mol
Molar mass of HC2H3O2 is 60.05196 g/mol
Molar mass of o4 is 63.9976 g/mol
Molar mass of o4 is 63.9976 g/mol
Molar mass of pm10 is 1449,12749 g/mol
Molar mass of CH4 is 16.04246 g/mol
Molar mass of C3H5O2Cl is CHEMICAL g/mol
Molar mass of P2O5 is 141.944524 g/mol
Molar mass of CH3COOH is 60.05196 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of NaHCO3 is 84,00660928 g/mol
Molar mass of Ca(C is I0)2 g/mol
Molar mass of LiBr is 86.845 g/mol
Calculate molecular weight
Molecular weights calculated on 01/24/16 | Molecular weights calculated on 01/26/16 |
Molecular masses on 12/26/15
Molecular masses on 01/25/15
Please let us know how we can improve this web app.