Molecular weights calculated on 12/09/15 | Molecular weights calculated on 12/11/15 |
Molar mass of Si2o is 72.1704 g/mol
Molar mass of C10H9N3O3 is 219.19676 g/mol
Molar mass of (Et4N)Ni(SC4H3N2)3 is 522.37956 g/mol
Molar mass of ca(H2PO4)2 is 234,052484 g/mol
Molar mass of N2 is 28.0134 g/mol
Molar mass of CsCl is 168.3584519 g/mol
Molar mass of CsCl is 168.3584519 g/mol
Molar mass of fe2o3 is 159.6882 g/mol
Molar mass of Yb(NO3)3*5H2O is 449,1451 g/mol
Molar mass of Ca(OH)2 is 74.09268 g/mol
Molar mass of Fe3(PO4)2 is 357.477724 g/mol
Molar mass of (CH3)2NCH2CH2N(CH3)2 is 116.20464 g/mol
Molar mass of C8H8O is 120.14852 g/mol
Molar mass of Fe3O4 is 231,5326 g/mol
Molar mass of Si is 28,0855 g/mol
Molar mass of Fe2(SO4)3 is 399.8778 g/mol
Molar mass of Zn is 65.38 g/mol
Molar mass of NaCH3COO*3H2O is 136.07962928 g/mol
Molar mass of Co is (No3)2.6H2O g/mol
Molar mass of Na2CO3 is 105.98843856 g/mol
Molar mass of C13H29ON4P is 288.369322 g/mol
Molar mass of NaNO3 is 84,99466928 g/mol
Molar mass of Co(No3)2 is 1613.539375 g/mol
Molar mass of Co(NO3)2 is 182.942995 g/mol
Molar mass of C13H29NO4P is 294.347422 g/mol
Molar mass of Fe(NO3)3(H2O)9 is 403.99722 g/mol
Molar mass of Fe(NO3)3(H2O)9 is 403.99722 g/mol
Molar mass of NH4(H2PO4) is 115,025702 g/mol
Molar mass of NH2(CH2)3NH(CH2)4NH(CH2)3NH2 is 202.34024 g/mol
Molar mass of [Pt(NH3)4Cl2]Cl2 is 405.01808 g/mol
Molar mass of Zn(OH)2 is 99,39468 g/mol
Molar mass of Zn(OH)2 is 99,39468 g/mol
Molar mass of RuCl3·0.5H2O is 216.43664 g/mol
Molar mass of CuCl2*4H2O is 206.51312 g/mol
Molar mass of RuCl3·H2O is 225.44428 g/mol
Molar mass of RuCl3·0.5H2O is 216.43664 g/mol
Molar mass of na2se is o3*H2O g/mol
Molar mass of na2se is *o3*H2O g/mol
Molar mass of Na2HPO4 is 141.95884056 g/mol
Molar mass of C4H7NH2 is structural g/mol
Molar mass of Fe2(MoO4)3 is 591.5628 g/mol
Molar mass of (COOH)2*2H2O is 126.06544 g/mol
Molar mass of CHOOCH is 58.03608 g/mol
Molar mass of C5H16 is 76.18054 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of Fe2(MoO4)3*2MoO3 is 879.4792 g/mol
Molar mass of CHOOCH is 58.03608 g/mol
Molar mass of c6h14 is 86.17536 g/mol
Molar mass of SIC5 is 219.02297 g/mol
Calculate molecular weight
Molecular weights calculated on 12/09/15 | Molecular weights calculated on 12/11/15 |
Molecular masses on 11/10/15
Molecular masses on 12/10/14
Please let us know how we can improve this web app.