Molecular weights calculated on 12/06/15 | Molecular weights calculated on 12/08/15 |
Molar mass of CaCl2*2H2O is 147.01456 g/mol
Molar mass of (Fe(NO3)3) is 241,8597 g/mol
Molar mass of CaCl2*2H2O is 147.01456 g/mol
Molar mass of CaCl2*2H2O is 147.01456 g/mol
Molar mass of FeCl3*6H2O is 270.29568 g/mol
Molar mass of CaCl2*2H2O is 147.01456 g/mol
Molar mass of CaCl2 is 110,984 g/mol
Molar mass of FeCl3 is 162.204 g/mol
Molar mass of KCl is 74.5513 g/mol
Molar mass of KCl is 74.5513 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of c is 12,0107 g/mol
Molar mass of NaHCO3(bakingsoda) is 84.00660928 g/mol
Molar mass of cl is 35.453 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of HCl is 36,46094 g/mol
Molar mass of C21H25ClN2O3 is 388.8878 g/mol
Molar mass of cu(NH3)4 is 131.66808 g/mol
Molar mass of cu(NH3)4 is 131.66808 g/mol
Molar mass of Cu(NH3)4 is 131.66808 g/mol
Molar mass of [Cu(NH3)4]SO4 is 227.73068 g/mol
Molar mass of CaCl2*2H2O is 147,01456 g/mol
Molar mass of H3PO4 is 97,995182 g/mol
Molar mass of (NH4)6(Mo7O24) is 1163,93636 g/mol
Molar mass of H3PO4 is 97,995182 g/mol
Molar mass of P2O5 is 141,944524 g/mol
Molar mass of P2O5 is 141,944524 g/mol
Molar mass of P2O5 is 141,944524 g/mol
Molar mass of P2O5 is 141,944524 g/mol
Molar mass of [Ru(bipy)2(Cl)2] is 273.046 g/mol
Molar mass of Br2(C4H8N2O2)(N2O2H7C4)Co is 449.970295 g/mol
Molar mass of K2CO3 is 138,2055 g/mol
Molar mass of K2CO3 is 138,2055 g/mol
Molar mass of C13H10ONBr is 276,1286 g/mol
Molar mass of K2CO3 is 138,2055 g/mol
Molar mass of H2O is 18,01528 g/mol
Molar mass of H2O is 18,01528 g/mol
Molar mass of Ca2(co2)3 is 433.75517 g/mol
Molar mass of (CH3)3CCOOH is 102.1317 g/mol
Molar mass of CH3COOH is 60,05196 g/mol
Molar mass of K2CO3*H2O is 156,22078 g/mol
Molar mass of K2CO3 is H2O g/mol
Molar mass of CH3COONa is 82,03378928 g/mol
Molar mass of SO4Li7 is 144,6496 g/mol
Molar mass of Ca is 40,078 g/mol
Molar mass of fePo4 is 891.7747216 g/mol
Molar mass of [(C7H7)Mo(CO)3]BF4 is 357.9253928 g/mol
Molar mass of fePO4 is 150.816362 g/mol
Molar mass of Na is 22.98976928 g/mol
Calculate molecular weight
Molecular weights calculated on 12/06/15 | Molecular weights calculated on 12/08/15 |
Molecular masses on 11/07/15
Molecular masses on 12/07/14
Please let us know how we can improve this web app.