Molecular weights calculated on 12/02/15 | Molecular weights calculated on 12/04/15 |
Molar mass of CaHPO4 is 136.057302 g/mol
Molar mass of CuN4H2(CH2)4(C6H11)2 is 343.99808 g/mol
Molar mass of (NH4)2S is 68.14192 g/mol
Molar mass of H2o is 18.01528 g/mol
Molar mass of (NH4)2S is 68.14192 g/mol
Molar mass of Na is 22.98976928 g/mol
Molar mass of Na2Cl is 81.43253856 g/mol
Molar mass of N2S2 is 92.1434 g/mol
Molar mass of ag2cr2O7 is 431,7244 g/mol
Molar mass of NaClO3 is 106.44096928 g/mol
Molar mass of KMnO4 is 158.033945 g/mol
Molar mass of OCl is 51.4524 g/mol
Molar mass of C is 12.0107 g/mol
Molar mass of KHC is 52.11694 g/mol
Molar mass of P is 30,973762 g/mol
Molar mass of Ag(NO3) is 169.8731 g/mol
Molar mass of HCI is 139.92311 g/mol
Molar mass of CaOCl2 is 126.9834 g/mol
Molar mass of C3H5(NO3)3 is 227.0865 g/mol
Molar mass of CuBr is 143.45 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of O is 15,9994 g/mol
Molar mass of C is 12.0107 g/mol
Molar mass of C2F2Cl4 is 203.8302064 g/mol
Molar mass of [Co(NH3)6]Cl3 is 267.475315 g/mol
Molar mass of Mg(NO3)2 is 148.3148 g/mol
Molar mass of H3PO4 is 97,995182 g/mol
Molar mass of IBr is 206.80847 g/mol
Molar mass of OCl is 51.4524 g/mol
Molar mass of NaCI is 161,90493928 g/mol
Molar mass of NH4Br is 97.94246 g/mol
Molar mass of (NH4)3PO4 is 149.086742 g/mol
Molar mass of C11H22O11 is 330,28578 g/mol
Molar mass of [Co(NH3)5Cl]Cl2 is 250.444795 g/mol
Molar mass of KNO3 is 101.1032 g/mol
Molar mass of Al2(SO4)3 is 342.1508772 g/mol
Molar mass of Ba(OH)2 is 171.34168 g/mol
Molar mass of CaCO3 is 100.0869 g/mol
Molar mass of HgO is 216.5894 g/mol
Molar mass of BCl3 is 117.17 g/mol
Molar mass of Al2 is 53.9630772 g/mol
Molar mass of [Co(NH2)4Cl2]Cl is 229.382515 g/mol
Molar mass of [(NH3)5Cr(OH)Cr(NH3)5]Cl5 is iupac g/mol
Molar mass of C8H10N4O2 is 194,1906 g/mol
Molar mass of AgCl is 143.3212 g/mol
Molar mass of Pb(NO3)2 is 331.2098 g/mol
Molar mass of CuN4H2(CH2)4(C6H11)2(ClO4)2 is 542.89928 g/mol
Molar mass of NaHCo3 is 200,79729428 g/mol
Molar mass of KPO4 is 134.069662 g/mol
Calculate molecular weight
Molecular weights calculated on 12/02/15 | Molecular weights calculated on 12/04/15 |
Molecular masses on 11/03/15
Molecular masses on 12/03/14
Please let us know how we can improve this web app.