Molecular weights calculated on 11/30/15 | Molecular weights calculated on 12/02/15 |
Molar mass of Mg is 24.305 g/mol
Molar mass of NaN2 is 51.00316928 g/mol
Molar mass of Cr2(SO4)3 is 392.18 g/mol
Molar mass of NaN3 is 65.00986928 g/mol
Molar mass of NaF is 41.98817248 g/mol
Molar mass of C3H8 is 44.09562 g/mol
Molar mass of Cl is 35.453 g/mol
Molar mass of C8H18O is 130.22792 g/mol
Molar mass of Na2Cr2O7 is 261.96753856 g/mol
Molar mass of Ca3(PO4)2 is 310.176724 g/mol
Molar mass of H6C4O4 is 118.08804 g/mol
Molar mass of CuSO4 is 159.6086 g/mol
Molar mass of C8O2H8 is 136.14792 g/mol
Molar mass of c6h12o6 is 180.15588 g/mol
Molar mass of c6h12o6 is 180.15588 g/mol
Molar mass of CH3CH2OH is 46.06844 g/mol
Molar mass of NaF is 41.98817248 g/mol
Molar mass of O is 15.9994 g/mol
Molar mass of C12H10O is 170.2072 g/mol
Molar mass of NaNO3 is 84.99466928 g/mol
Molar mass of Mg(OH)2 is 58.31968 g/mol
Molar mass of FO is 34.9978032 g/mol
Molar mass of fe is 55,845 g/mol
Molar mass of H2O2 is 34.01468 g/mol
Molar mass of Al2(SO4)3 is 342.1508772 g/mol
Molar mass of Al2(SO4)3 is 342.1508772 g/mol
Molar mass of ni is 58.6934 g/mol
Molar mass of S is 32,065 g/mol
Molar mass of MgSO4 is 120.3676 g/mol
Molar mass of sn is 118.71 g/mol
Molar mass of Al(OH)3 is 78.0035586 g/mol
Molar mass of C is 12.0107 g/mol
Molar mass of Na2SO4 is 142.04213856 g/mol
Molar mass of Al(C2H3O2)3 is 204.1135986 g/mol
Molar mass of CrO is 67.9955 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of h2o is 18.01528 g/mol
Molar mass of C2H5OC2H5 is 74.1216 g/mol
Molar mass of AgCn is 393.04231 g/mol
Molar mass of CH3CH(C2H5)CH(CH2CH3)CH2CH3 is 128,2551 g/mol
Molar mass of AlS is 59.0465386 g/mol
Molar mass of CaH2 is 42.09388 g/mol
Molar mass of MgCl2 is 95.211 g/mol
Molar mass of BeCl is 44.465182 g/mol
Molar mass of AgCH3COO is 166.91222 g/mol
Molar mass of CF2Cl2 is 120.9135064 g/mol
Molar mass of Cu1Ar is 103.494 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of H2O is 18.01528 g/mol
Calculate molecular weight
Molecular weights calculated on 11/30/15 | Molecular weights calculated on 12/02/15 |
Molecular masses on 11/01/15
Molecular masses on 12/01/14
Please let us know how we can improve this web app.