Molecular weights calculated on 11/03/15 | Molecular weights calculated on 11/05/15 |
Molar mass of CH3NH3I is 158,96951 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of CaH4P2O8 is 234.052484 g/mol
Molar mass of Mg2Cl is 84.063 g/mol
Molar mass of HC2H3O2 is 60.05196 g/mol
Molar mass of Pd(OCHCH3)2 is 194,52512 g/mol
Molar mass of Pd(OCHCH3)2 is 194,52512 g/mol
Molar mass of C44H8N4F20Mn(Cl)(CH3CN) is 1103.972149 g/mol
Molar mass of C4H9 is KOH g/mol
Molar mass of CaH6P2O9 is 252.067764 g/mol
Molar mass of CrCl2*6H2O is 230.99378 g/mol
Molar mass of C4H9 is + g/mol
Molar mass of NO2 is 46.0055 g/mol
Molar mass of p is 30.973762 g/mol
Molar mass of InBr3 is 354.53 g/mol
Molar mass of CH4O5 is 96,03946 g/mol
Molar mass of In is 114.818 g/mol
Molar mass of CHCl3 is 119.37764 g/mol
Molar mass of Ni(HCO2)2 is 148.72828 g/mol
Molar mass of C44H8N4F20Mn(Cl)(CH3CN)(H2O) is 1121.987429 g/mol
Molar mass of AgI is 234.77267 g/mol
Molar mass of InBr is 194.722 g/mol
Molar mass of Na2[B4O5(OH)4]*8H2O is 381.37213856 g/mol
Molar mass of N2o is 44,0128 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of Cl is 35.453 g/mol
Molar mass of ZnSO4*6H2O is 269.53428 g/mol
Molar mass of CH3COOH is 60.05196 g/mol
Molar mass of CH3COO is 59.04402 g/mol
Molar mass of cl is 35.453 g/mol
Molar mass of HBr is 80,91194 g/mol
Molar mass of C12H22O1 is 182.30248 g/mol
Molar mass of ZnO is 81.3794 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of I2 is 253.80894 g/mol
Molar mass of SO4 is 96,0626 g/mol
Molar mass of S is 32,065 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of SnF2 is 156.7068064 g/mol
Molar mass of Bi2O3 is 465.959 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of S2O3 is 112.1282 g/mol
Molar mass of Na2S2O3 is 158.10773856 g/mol
Molar mass of o is 15.9994 g/mol
Molar mass of Fe is 55.845 g/mol
Molar mass of ZnO is 81.3794 g/mol
Molar mass of C44H8N4F20Mn(Cl)(CH3CN)(H2O) is 1121.987429 g/mol
Molar mass of FeSO4 is 151.9076 g/mol
Molar mass of C44H8N4F20Mn(Cl)(CH3CN) is 1103.972149 g/mol
Calculate molecular weight
Molecular weights calculated on 11/03/15 | Molecular weights calculated on 11/05/15 |
Molecular masses on 10/05/15
Molecular masses on 11/04/14
Please let us know how we can improve this web app.