Molecular weights calculated on 10/07/15 | Molecular weights calculated on 10/09/15 |
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of C2H5OH is 46,06844 g/mol
Molar mass of Fe is 55.845 g/mol
Molar mass of HClO3 is 84.45914 g/mol
Molar mass of Mg3(SbO3)2 is 412,4314 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of Na2SO4 is 142,04213856 g/mol
Molar mass of Na3PO4 is 163.94066984 g/mol
Molar mass of CoSO4 is 154.995795 g/mol
Molar mass of P2O5 is 141.944524 g/mol
Molar mass of UF4 is 314.0225228 g/mol
Molar mass of C3H7OH is 60,09502 g/mol
Molar mass of NC3h9 is 59.11026 g/mol
Molar mass of NaBr is 102.89376928 g/mol
Molar mass of Ni(O(C6H4)CHN((CH3)2CH))2 is 383.11016 g/mol
Molar mass of HBr is 80.91194 g/mol
Molar mass of NaC7H5O2 is 144.10316928 g/mol
Molar mass of Na2S2 is 110.10953856 g/mol
Molar mass of C6H8O6 is 176.12412 g/mol
Molar mass of N2O is 44.0128 g/mol
Molar mass of CH4 is 16.04246 g/mol
Molar mass of Ca(NO3)2 is 164.0878 g/mol
Molar mass of Na2C6H6O7 is 236.08717856 g/mol
Molar mass of Na2C6H6O7 is 236.08717856 g/mol
Molar mass of Hg is 200.59 g/mol
Molar mass of Hg is 200.59 g/mol
Molar mass of Al2(SO4)3 is 342.1508772 g/mol
Molar mass of FeO is 71,8444 g/mol
Molar mass of ZnCO3 is 125.3889 g/mol
Molar mass of H3PO4 is 97.995182 g/mol
Molar mass of y2o3 is 225.8099 g/mol
Molar mass of KOH is 56.10564 g/mol
Molar mass of k is 39.0983 g/mol
Molar mass of k is 39.0983 g/mol
Molar mass of h20 is 20.1588 g/mol
Molar mass of [Cu(NH3)4]SO4 is 227.73068 g/mol
Molar mass of Br2 is 159.808 g/mol
Molar mass of TiCl4 is 189.679 g/mol
Molar mass of NO2 is 46.0055 g/mol
Molar mass of Fe2O3 is 159.6882 g/mol
Molar mass of Cu is 63.546 g/mol
Molar mass of C6H6 is 78.11184 g/mol
Molar mass of KAl(SO4)2*12H2O is 474.3883986 g/mol
Molar mass of MgBr is 104.209 g/mol
Molar mass of n(C3H8O3) is 106.10052 g/mol
Molar mass of K2SO4 is 174.2592 g/mol
Molar mass of CaB(OH)SiO4 is 159,97944 g/mol
Molar mass of MgO is 40.3044 g/mol
Calculate molecular weight
Molecular weights calculated on 10/07/15 | Molecular weights calculated on 10/09/15 |
Molecular masses on 09/08/15
Molecular masses on 10/08/14
Please let us know how we can improve this web app.