Molecular weights calculated on 09/30/15 | Molecular weights calculated on 10/02/15 |
Molar mass of Ce8Zr2O20 is 1623.364 g/mol
Molar mass of P(OPh)3(PPh3)P(OPh)3RhSB8H9 is 1113.382746 g/mol
Molar mass of C12H22O11 is 342,29648 g/mol
Molar mass of I2 is 253.80894 g/mol
Molar mass of Ce2Zr8O20 is 1330.012 g/mol
Molar mass of C12H13O6I is 380,13249 g/mol
Molar mass of C2H2O4 is 90.03488 g/mol
Molar mass of C9H8O4 is 180.15742 g/mol
Molar mass of C12H13O6I is 380,13249 g/mol
Molar mass of (NH4)2SO4 is 132.13952 g/mol
Molar mass of ZnSO4 is 161.4426 g/mol
Molar mass of Ph4P2S2CH2 is 448.519704 g/mol
Molar mass of FeCl3 is 3h20 g/mol
Molar mass of FeCl3 is 3h20 g/mol
Molar mass of H3AsO4 is 141.94302 g/mol
Molar mass of H3AsO4 is 141.94302 g/mol
Molar mass of c16 is 192.1712 g/mol
Molar mass of H3AsO4 is 141.94302 g/mol
Molar mass of C12H22O11 is 342,29648 g/mol
Molar mass of C25H22P2S2 is 448.519704 g/mol
Molar mass of H2IrCl6 is 406.95088 g/mol
Molar mass of c6H18 is 90,20712 g/mol
Molar mass of HCl is 36,46094 g/mol
Molar mass of n2 is 28.0134 g/mol
Molar mass of H2SO4 is 98.07848 g/mol
Molar mass of K is Mn g/mol
Molar mass of P(C6H5)3 is 262.285462 g/mol
Molar mass of KMn2 is 148,97439 g/mol
Molar mass of Ca(OH)2 is 74,09268 g/mol
Molar mass of CaCO3 is 100,0869 g/mol
Molar mass of MgCl2 is 95.211 g/mol
Molar mass of C6H12HCl is 120,62042 g/mol
Molar mass of HCON(CH3)2 is 73.09378 g/mol
Molar mass of C2H2OH is 43,04462 g/mol
Molar mass of C6H5NH2 is 93.12648 g/mol
Molar mass of C12H13O8I is 412,13129 g/mol
Molar mass of C2H5OH is 46.06844 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of C26H24P2S2 is 462.546284 g/mol
Molar mass of Fe(NO3)3 is 241.8597 g/mol
Molar mass of C28H32N2O5HCl is 513.02502 g/mol
Molar mass of C2H3Cl3O2 is 165.40302 g/mol
Molar mass of C28H32N2O5 is 476.56408 g/mol
Molar mass of Ca is (PO4)2 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of C7N7NO2 is 228.1273 g/mol
Molar mass of IrCl(CO)(P(C6H5)3)2 is 780.251024 g/mol
Molar mass of Na2CO3*10H2O is 286,14123856 g/mol
Molar mass of Fe(OH)2Cl is 125,31268 g/mol
Calculate molecular weight
Molecular weights calculated on 09/30/15 | Molecular weights calculated on 10/02/15 |
Molecular masses on 09/01/15
Molecular masses on 10/01/14
Please let us know how we can improve this web app.